Pingyangmycin
{{Short description|Glycopeptide antibiotic used to treat various cancers}}
{{Drugbox
| IUPAC_name = (2R,3S,4S,5R,6R)-2-
| image = Pingyangmycin.svg
| width = 300
| pregnancy_category = D
| legal_status = Rx-only
| routes_of_administration = intravenous, intra-arterial, intramuscular, intratumoral
| metabolism = amidase
| elimination_half-life = 1.3 hours
| excretion = renal (25-50%)
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 11116-32-8
| CAS_supplemental =
{{CAS|55658-47-4|(hydrochloride)}}
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5DY91Y7601
| PubChem = 84046
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8232875
| synonyms = Bleomycin A5
| C=57 | H=89 | N=19 | O=21 | S=2
| smiles = C[C@@H](O)[C@H](NC(=O)[C@@H](C)[C@H](O)[C@@H](C)NC(=O)[C@@H](NC(=O)c1nc(nc(N)c1C)[C@H](CC(N)=O)NC[C@H](N)C(N)=O)[C@@H](O[C@@H]1O[C@@H](CO)[C@@H](O)[C@H](O)[C@@H]1O[C@H]1O[C@H](CO)[C@@H](O)[C@H](OC(N)=O)[C@@H]1O)c1c[nH]cn1)C(=O)NCCc1nc(cs1)-c1nc(cs1)C(=O)NCCCNCCCCN
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI =1S/C57H89N19O21S2/c1-22-35(73-48(76-46(22)61)27(14-33(60)80)68-15-26(59)47(62)86)52(90)75-37(43(28-16-65-21-69-28)95-56-45(41(84)39(82)31(17-77)94-56)96-55-42(85)44(97-57(63)92)40(83)32(18-78)93-55)53(91)70-24(3)38(81)23(2)49(87)74-36(25(4)79)51(89)67-13-8-34-71-30(20-98-34)54-72-29(19-99-54)50(88)66-12-7-11-64-10-6-5-9-58/h16,19-21,23-27,31-32,36-45,55-56,64,68,77-79,81-85H,5-15,17-18,58-59H2,1-4H3,(H2,60,80)(H2,62,86)(H2,63,92)(H,65,69)(H,66,88)(H,67,89)(H,70,91)(H,74,87)(H,75,90)(H2,61,73,76)/t23-,24+,25+,26-,27-,31-,32+,36-,37-,38-,39+,40+,41-,42-,43-,44-,45-,55+,56-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = QYOAUOAXCQAEMW-UTXKDXHTSA-N
}}
Pingyangmycin (also known as bleomycin A5) is an antitumor glycopeptide antibiotic belonging to the bleomycin family, which is produced by Streptomyces verticillus var. pingyangensis n.sp., a variety of Streptomyces verticillus. It was discovered in 1969 at Pingyang County of Zhejiang Province in China, and was brought into clinical use in 1978.{{cite journal | vauthors = Lin FT, Li DD, Yang XP, Li Q, Xue YC, Zhen YS | title = [Antitumor activity and preclinical pharmacologic evaluation of pingyangmycin (author's transl)] | journal = Zhonghua Zhong Liu Za Zhi [Chinese Journal of Oncology] | volume = 1 | issue = 3 | pages = 161–6 | year = 1979 | pmid = 95444 }}
In China, pingyangmycin has largely superseded bleomycin A2 (commonly known as "bleomycin"), since according to Chinese sources it is more effective, costs less, is easier to get, can treat a larger variety of cancers (such as breast cancer and liver cancer) and causes less lung injury.{{cite journal | vauthors = Zheng JW, Yang XJ, Wang YA, He Y, Ye WM, Zhang ZY | title = Intralesional injection of Pingyangmycin for vascular malformations in oral and maxillofacial regions: an evaluation of 297 consecutive patients | journal = Oral Oncology | volume = 45 | issue = 10 | pages = 872–6 | date = October 2009 | pmid = 19628423 | doi = 10.1016/j.oraloncology.2009.02.011 }}{{cite journal | vauthors = Xu HZ, Zhang HY | title = [The isolation and identification of pingyangmycin (author's transl)] | journal = Yao Xue Xue Bao = Acta Pharmaceutica Sinica | volume = 15 | issue = 10 | pages = 609–14 | date = October 1980 | pmid = 6167140 }} Though pingyangmycin and bleomycin can each cause pulmonary fibrosis, pingyangmycin's most serious side effect - which it does not share with bleomycin - is anaphylactic shock, which is rare, but may happen even in a low dose, and can be fatal.{{cite journal | vauthors = Shou BQ, Mao Z, Zhang SL, Yang Z | title = [Allergy caused by minidose and low concentration Pingyangmycin: a case report] | journal = Hua Xi Kou Qiang Yi Xue Za Zhi = Huaxi Kouqiang Yixue Zazhi = West China Journal of Stomatology | volume = 27 | issue = 5 | pages = 572–3 | date = October 2009 | pmid = 19927737 }} In addition, it causes a higher incidence of fever than bleomycin; the occurrence of this complication in patients is between 20 and 50%.