Pinotin A
{{chembox
| Watchedfields = changed
| verifiedrevid = 448394816
| Name = Pinotin A
| ImageFile = Pinotin A.svg
| ImageSize = 200px
| ImageName = Chemical structure of pinotin A
| ImageAlt = Chemical structure of pinotin A
| IUPACName =
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 663910-41-6
| CASNo_Ref = {{Cascite|changed|CAS}}
| PubChem = 21674154
| ChemSpiderID = 10286568
| SMILES = COc1cc(cc(c1O)OC)c2c(c3c4c([o+]2)cc(cc4OC(=C3)c5ccc(c(c5)O)O)O)O[C@H]6[C@@H]([C@H]([C@@H]([C@H](O6)CO)O)O)O
| StdInChI = 1S/C31H28O14/c1-40-21-6-13(7-22(41-2)25(21)36)29-30(45-31-28(39)27(38)26(37)23(11-32)44-31)15-10-18(12-3-4-16(34)17(35)5-12)42-19-8-14(33)9-20(43-29)24(15)19/h3-10,23,26-28,31-32,37-39H,11H2,1-2H3,(H3-,33,34,35,36)/p+1/t23-,26-,27+,28-,31+/m1/s1
| StdInChIKey = RFTHDRVOYDHSOC-BGXVWEPQSA-O
| MeSHName =
}}
|Section2={{Chembox Properties
| Formula = C31H29O14+
| MolarMass = 625.55 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section3={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
| GHS_ref =
}}
}}
Pinotin A is a pinotin, a type of pyranoanthocyanins and a class of phenolic compounds found in red wine.Investigations on Anthocyanins in Wines from Vitis vinifera cv. Pinotage: Factors Influencing the Formation of Pinotin A and Its Correlation with Wine Age. Schwarz Michael, Hofmann Glenn and Winterhalter Peter, J. Agric. Food Chem., 2004, 52 (3): 498–504. {{doi|10.1021/jf035034f}}Variation of pyranoanthocyanins in red wines of different varieties and vintages and the impact of pinotin A addition on their color parameters. Michael Rentzsch, Fabian Weber, Dominik Durner, Ulrich Fischer and Peter Winterhalter, European Food Research and Technology, Volume 229, Number 4, pp. 689-696, {{doi|10.1007/s00217-009-1102-4}}
See also
References
{{reflist}}
External links
- [http://www.phenol-explorer.eu/compounds/72 Pinotin A on www.phenol-explorer.eu]
{{Pyranoanthocyanidin}}
{{aromatic-stub}}