Piperocaine

{{Short description|Chemical compound}}

{{more citations needed|date=October 2021}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 457288801

| IUPAC_name = 3-(2-Methylpiperidin-1-yl)propyl benzoate

| image = Piperocaine.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 136-82-3

| ATC_prefix = none

| ATC_suffix =

| PubChem = 10782

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = F66XUI6GZL

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 127865

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 10326

| C=16 | H=23 | N=1 | O=2

| smiles = CC1CCCCN1CCCOC(C2=CC=CC=C2)=O

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H23NO2/c1-14-8-5-6-11-17(14)12-7-13-19-16(18)15-9-3-2-4-10-15/h2-4,9-10,14H,5-8,11-13H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = YQKAVWCGQQXBGW-UHFFFAOYSA-N

}}

Piperocaine is a local anesthetic drug developed in the 1920s and used as its hydrochloride salt for infiltration and nerve blocks.

Synthesis

File:Piperocaine synthesis.svg

Alkylation between 3-chloropropyl benzoate [942-95-0] (1) and Pipicoline [109-05-7] (2) provides piperocaine (3).

See also

References

{{Reflist}}

Further reading

  • {{cite journal | vauthors = Tiedt TN, Albuquerque EX, Bakry NM, Eldefrawi ME, Eldefrawi AT | title = Voltage- and time-dependent actions of piperocaine on the ion channel of the acetylcholine receptor | journal = Molecular Pharmacology | volume = 16 | issue = 3 | pages = 909–21 | date = November 1979 | pmid = 316855 | url = https://molpharm.aspetjournals.org/content/16/3/909.short }}{{Cite journal|date=1950-02-01|title=A Preliminary Study of the Efficiency of Piperocaine Hydrochloride as a Local Anesthetic in Dental Surgery|url=https://www.sciencedirect.com/science/article/abs/pii/S000281775002004X|journal=The Journal of the American Dental Association|language=en|volume=40|issue=2|pages=163–169|doi=10.14219/jada.archive.1950.0022|issn=0002-8177|last1=Costich |first1=Emmett R. |pmid=15402120 |url-access=subscription}}

{{Local anesthetics}}

{{Ion channel modulators}}

Category:Local anesthetics

Category:Piperidines

Category:Benzoate esters

{{nervous-system-drug-stub}}