Piperocaine
{{Short description|Chemical compound}}
{{more citations needed|date=October 2021}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 457288801
| IUPAC_name = 3-(2-Methylpiperidin-1-yl)propyl benzoate
| image = Piperocaine.png
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 136-82-3
| ATC_prefix = none
| ATC_suffix =
| PubChem = 10782
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = F66XUI6GZL
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 127865
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 10326
| C=16 | H=23 | N=1 | O=2
| smiles = CC1CCCCN1CCCOC(C2=CC=CC=C2)=O
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H23NO2/c1-14-8-5-6-11-17(14)12-7-13-19-16(18)15-9-3-2-4-10-15/h2-4,9-10,14H,5-8,11-13H2,1H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = YQKAVWCGQQXBGW-UHFFFAOYSA-N
}}
Piperocaine is a local anesthetic drug developed in the 1920s and used as its hydrochloride salt for infiltration and nerve blocks.
Synthesis
File:Piperocaine synthesis.svg
Alkylation between 3-chloropropyl benzoate [942-95-0] (1) and Pipicoline [109-05-7] (2) provides piperocaine (3).
See also
References
{{Reflist}}
Further reading
- {{cite journal | vauthors = Tiedt TN, Albuquerque EX, Bakry NM, Eldefrawi ME, Eldefrawi AT | title = Voltage- and time-dependent actions of piperocaine on the ion channel of the acetylcholine receptor | journal = Molecular Pharmacology | volume = 16 | issue = 3 | pages = 909–21 | date = November 1979 | pmid = 316855 | url = https://molpharm.aspetjournals.org/content/16/3/909.short }}{{Cite journal|date=1950-02-01|title=A Preliminary Study of the Efficiency of Piperocaine Hydrochloride as a Local Anesthetic in Dental Surgery|url=https://www.sciencedirect.com/science/article/abs/pii/S000281775002004X|journal=The Journal of the American Dental Association|language=en|volume=40|issue=2|pages=163–169|doi=10.14219/jada.archive.1950.0022|issn=0002-8177|last1=Costich |first1=Emmett R. |pmid=15402120 |url-access=subscription}}
{{Local anesthetics}}
{{Ion channel modulators}}
{{nervous-system-drug-stub}}