Pipobroman

{{Short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 464207677

| IUPAC_name = 3-bromo-1-[4-(3-bromopropanoyl) piperazin-1-yl]-propan-1-one

| image = Pipobroman.svg

| tradename = Vercite, Vercyte

| Drugs.com = {{drugs.com|international|pipobroman}}

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 7271

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 54-91-1

| ATC_prefix = L01

| ATC_suffix = AX02

| ATC_supplemental =

| PubChem = 4842

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00236

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4676

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6Q99RDT97R

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D00467

| ChEBI = 8242

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1585

| C=10 | H=16 | Br=2 | N=2 | O=2

| smiles = O=C(N1CCN(C(=O)CCBr)CC1)CCBr

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C10H16Br2N2O2/c11-3-1-9(15)13-5-7-14(8-6-13)10(16)2-4-12/h1-8H2

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = NJBFOOCLYDNZJN-UHFFFAOYSA-N

}}

Pipobroman (trade names Vercite, Vercyte) is an anti-cancer drug that probably acts as an alkylating agent,{{cite journal | vauthors = Passamonti F, Lazzarino M | title = Treatment of polycythemia vera and essential thrombocythemia: the role of pipobroman | journal = Leukemia & Lymphoma | volume = 44 | issue = 9 | pages = 1483–8 | date = September 2003 | pmid = 14565648 | doi = 10.3109/10428190309178768 }} and is marketed in France and Italy.{{cite web | work = Drugs.com | url = https://www.drugs.com/international/pipobroman.html | title = Pipobroman }}