Pirnabine

{{Short description|Chemical compound}}

{{Drugbox

| Watchedfields = changed

| verifiedrevid = 444058373

| IUPAC_name = (3,6,6,9-Tetramethyl-7,8,9,10-tetrahydrobenzo[c]chromen-1-yl) acetate

| image = Pirnabine Structure.svg

| width = 200

| tradename =

| legal_status =

| routes_of_administration =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 19825-63-9

| PubChem = 50137

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = S3FHL03F60

| ChemSpiderID = 45469

| C=19 | H=24 | O=3

| smiles = O=C(C)Oc1cc(C)cc(OC2(C)C)c1C(C3)=C2CCC3C

| StdInChI = 1S/C19H24O3/c1-11-6-7-15-14(8-11)18-16(21-13(3)20)9-12(2)10-17(18)22-19(15,4)5/h9-11H,6-8H2,1-5H3

| StdInChIKey = AADNQNOXNWEYHS-UHFFFAOYSA-N

}}

Pirnabine (SP-304) is a synthetic cannabinoid receptor ligand, which was developed for the treatment of glaucoma.{{Cite journal | doi = 10.1001/jama.1979.03290270051024 | title = New Names | journal = JAMA: The Journal of the American Medical Association | volume = 241 | pages = 65 | year = 1979 }}