Platinum(II) acetate

{{Chembox

|ImageFile = Pt4(OAc)8 (PLATAC10).png

|OtherNames = platinum diacetate, platinum acetate

|Section1 = {{Chembox Identifiers

| CASNo = 3375-34-6

| CASNo_Ref = {{Cascite|changed|EPA}}

|ChemSpiderID = 9326225

|PubChem = 11151117

|StdInChI=1S/2C2H4O2.Pt/c2*1-2(3)4;/h2*1H3,(H,3,4);/q;;+2/p-2

|StdInChIKey = QCSGLAMXZCLSJW-UHFFFAOYSA-L

|SMILES = CC(=O)[O-].CC(=O)[O-].[Pt+2]

}}

|Section2={{Chembox Properties

|Formula = Pt(CH3CO2)2

|MolarMass = 315.19 g/mol

|Appearance = purple solid

|Density = 3.374 g/cm3

|MeltingPtC = 245

|MeltingPt_notes = decomposition

|Solubility = chloroform}}

|Section3 = {{Chembox Structure

|Structure_ref =

|CrystalStruct = tetragonal

|SpaceGroup = P43212, No. 96

|LattConst_a = 10.254 Å

|LattConst_c = 50.494 Å

|UnitCellFormulas = 8 tetrameric molecules

}}

}}

Platinum(II) acetate is a purple-colored coordination complex. The complex adopts an unusual structure consisting of a square array of Pt atoms.

Preparation

Several syntheses of platinum(II) acetate have been reported. Geoffrey Wilkinson et al. reported a highly temperamental synthesis from sodium hexahydroxyplatinate, nitric acid, and acetic acid. This intermediate solution was reducted with formic acid.{{cite journal | doi = 10.1039/jr9650003632 | title = Carboxylates of Palladium, Platinum, and Rhodium, and Their Adducts | year = 1965 |author1=T. A. Stephenson |author2=S. M. Morehouse |author3=A. R. Powell |author4=J. P. Heffer |author5=G. Wilkinson | journal = Journal of the Chemical Society | pages = 3632–3640}}

Alternatively, the complex can be prepared by the reaction of silver acetate with platinum(II) chloride.{{cite journal|author1=Marino Basato|author2=Andrea Biffis|author3=Gianluca Martinati|author4=Cristina Tubaro|author5=Alfonso Venzo|author6=Paolo Ganis|author7=Franco Benetollo|year=2003|title=Reaction of Platinum Acetate with Phosphines and Molecular Structure of trans-[Pt(OAc)2(PPh3)2]|journal=Inorganica Chimica Acta|volume=355|pages=399–403|doi=10.1016/S0020-1693(03)00314-1}}

Structure

According to X-ray crystallography, the complex is tetrameric, in contrast to the trimeric palladium analog.{{cite journal |doi=10.1016/j.mencom.2019.09.003|title=Structure and Quantum Chemical Study of Crystalline Platinum(II) Acetate|year=2019|last1=Markov|first1=Alexander A.|last2=Yakushev|first2=Ilya A.|last3=Churakov|first3=Andrey V.|last4=Khrustalev|first4=Victor N.|last5=Cherkashina|first5=Natalia V.|last6=Stolarov|first6=Igor P.|last7=Gekhman|first7=Alexander E.|last8=Vargaftik|first8=Michael N.|journal=Mendeleev Communications|volume=29|issue=5|pages=489–491}} The four platinum atoms form a square cluster, with eight bridging acetate ligands surrounding them. The compound has slight distortions from idealized D2d symmetry. The crystal is tetragonal.{{Cite journal|last1=de C. T. Carrondo|first1=Maria A. A. F.|last2=Skapski|first2=Andrzej C.|date=1976|title=X-Ray crystal structure of tetrameric platinum(II) acetate: a square-cluster complex with short Pt–Pt bonds and octahedral co-ordination geometry|url=http://xlink.rsc.org/?DOI=C39760000410|journal=J. Chem. Soc., Chem. Commun.|language=en|issue=11|pages=410–411|doi=10.1039/C39760000410|issn=0022-4936}}

References

{{Reflist}}

{{Platinum compounds}}

{{clear}}

{{Acetates}}

Category:Platinum complexes

Acetate,2

Category:Acetates