Polmacoxib

{{Short description|COX-2 selective NSAID medication}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| verifiedrevid =

| tradename = Acelex

| IUPAC_name = 4-(3-(3-Fluorophenyl)-5,5-dimethyl-4-oxo-4,5-dihydrofuran-2-yl)-benzenesulfonamide

| image = Polmacoxib.svg

| CAS_number = 301692-76-2

| ATC_prefix = M01

| ATC_suffix = AH07

| ATC_supplemental =

| PubChem = 9841854

| DrugBank =

| ChemSpiderID = 8017569

| UNII = IJ34D6YPAO

| ChEBI =

| ChEMBL = 166863

| synonyms = CG100649

| KEGG_Ref = {{keggcite|correct|kegg}}

| KEGG = D10656

| chemical_formula =

| C=18 | H=16 | F=1 | N=1 | O=4 | S=1

| smiles = CC1(C(=O)C(=C(O1)C2=CC=C(C=C2)S(=O)(=O)N)C3=CC(=CC=C3)F)C

| StdInChI = 1S/C18H16FNO4S/c1-18(2)17(21)15(12-4-3-5-13(19)10-12)16(24-18)11-6-8-14(9-7-11)25(20,22)23/h3-10H,1-2H3,(H2,20,22,23)

| StdInChIKey = IJWPAFMIFNSIGD-UHFFFAOYSA-N

}}

Polmacoxib (trade name Acelex) is a nonsteroidal anti-inflammatory drug (NSAID) used to treat osteoarthritis. It was developed as CG100649 and approved for use in South Korea in February 2015.{{cite press release |title=CrystalGenomics Receives MFDS Approval for Acelex (Polmacoxib) |url=http://www.prnewswire.com/news-releases/crystalgenomics-receives-mfds-approval-for-acelex-polmacoxib-300031999.html |publisher=PR Newswire}} It inhibits the enzymes carbonic anhydrase and COX-2.

A study in healthy volunteers showed drug effects on urinary prostaglandin metabolites for both polmacoxib and celecoxib that suggest a similar cardiovascular risk profile.{{cite journal | vauthors = Skarke C, Alamuddin N, Lawson JA, Cen L, Propert KJ, Fitzgerald GA | title = Comparative impact on prostanoid biosynthesis of celecoxib and the novel nonsteroidal anti-inflammatory drug CG100649 | journal = Clinical Pharmacology and Therapeutics | volume = 91 | issue = 6 | pages = 986–93 | date = June 2012 | pmid = 22278334 | pmc = 3740579 | doi = 10.1038/clpt.2012.3 }} Further work by this group developed dose-exposure relationships of polmacoxib to guide clinical development strategies.{{cite journal | vauthors = Hirankarn S, Barrett JS, Alamuddin N, FitzGerald GA, Skarke C | title = GCG100649, A Novel Cyclooxygenase-2 Inhibitor, Exhibits a Drug Disposition Profile in Healthy Volunteers Compatible With High Affinity to Carbonic Anhydrase-I/II: Preliminary Dose-Exposure Relationships to Define Clinical Development Strategies | journal = Clinical Pharmacology in Drug Development | volume = 2 | issue = 4 | pages = 379–86 | date = October 2013 | pmid = 27121942 | doi = 10.1002/cpdd.47 | s2cid = 35992507 }}