Porfimer sodium

{{short description|Pharmaceutical drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464210732

| IUPAC_name =

| image = Porfimer Sodium.png

| width = 300

| tradename = Photofrin

| Drugs.com = {{drugs.com|CDI|porfimer_sodium}}

| licence_EU = yes

| licence_US = Photofrin

| pregnancy_AU =

| pregnancy_US = C

| legal_AU =

| legal_UK =

| legal_US = Rx-only

| routes_of_administration = Intravenous

| bioavailability = NA

| protein_bound = ~90%

| metabolism =

| elimination_half-life = 21.5 days (mean)

| excretion = Fecal

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 87806-31-3

| index2_label = ethyl ether

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 97067-70-4

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = 625J2HS54G

| CAS_supplemental =

| ATC_prefix = L01

| ATC_suffix = XD01

| ATC_supplemental =

| PubChem = 57166

| DrugBank_Ref = {{drugbankcite|changed|drugbank}}

| DrugBank = DB00707

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 10482283

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = Y3834SIK5F

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1201707

| C=68 | H=74 | N=8 | O=11

| chemical_formula_comment = (for n=0)

| molecular_weight = 1179.36 g/mol (for n=0)

| smiles = [Na+].CC(O)C1=C(C)C=2C=C5NC(=CC4=NC(=CC=3NC(C=C1N=2)=C(C)C=3CCC(O)=O)C(CCC(O)=O)=C4C)C(C)=C5C(C)OC(C)C6=C(C)C=7C=C%10NC(=CC9=NC(=CC=8NC(C=C6N=7)=C(C)C=8CCC(O)=O)C(CCC(O)=O)=C9C)C(C)=C%10C(C)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C68H74N8O11.Na/c1-29-41(13-17-61(79)80)53-28-56-44(16-20-64(85)86)32(4)48(72-56)24-59-68(36(8)52(76-59)25-58-65(37(9)77)33(5)49(73-58)21-45(29)69-53)40(12)87-39(11)67-35(7)50-22-46-30(2)42(14-18-62(81)82)54(70-46)27-55-43(15-19-63(83)84)31(3)47(71-55)23-57-66(38(10)78)34(6)51(74-57)26-60(67)75-50;/h21-28,37-40,71-73,75,77-78H,13-20H2,1-12H3,(H,79,80)(H,81,82)(H,83,84)(H,85,86);/q;+1/b45-21-,46-22-,47-23-,48-24-,49-21-,50-22-,51-26-,52-25-,53-28-,54-27-,55-27-,56-28-,57-23-,58-25-,59-24-,60-26-;

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CGQHMICGJYKFFJ-ZLJVSRBASA-N

}}

Porfimer sodium, sold as Photofrin, is a photosensitizer used in photodynamic therapy and radiation therapy and for palliative treatment of obstructing endobronchial non-small cell lung carcinoma and obstructing esophageal cancer.

Porfimer is a mixture of oligomers formed by ether and ester linkages of up to eight porphyrin units.{{cite web |url=http://www.accessdata.fda.gov/drugsatfda_docs/label/2008/020451s019lbl.pdf |archive-url=https://web.archive.org/web/20121016140123/http://www.accessdata.fda.gov/drugsatfda_docs/label/2008/020451s019lbl.pdf |url-status=dead |archive-date=October 16, 2012 |title=Porfimer injection Prescribing information}} In practice, a red light source emitting at 630 nm is used to excite the Porfimer oligomers.{{cite journal | vauthors = Usuda J, Kato H, Okunaka T, Furukawa K, Tsutsui H, Yamada K, Suga Y, Honda H, Nagatsuka Y, Ohira T, Tsuboi M, Hirano T | display-authors = 6 | title = Photodynamic therapy (PDT) for lung cancers | journal = Journal of Thoracic Oncology | volume = 1 | issue = 5 | pages = 489–93 | date = June 2006 | pmid = 17409904 | doi = 10.1016/S1556-0864(15)31616-6 | doi-access = free }}

Porfimer is Haematoporphyrin Derivative (HpD) (See PDT).