Potassium lactate
{{redirect|E326|the locomotive|FS Class E326}}
{{Chembox
| Verifiedfields = changed
| verifiedrevid = 477512901
| ImageFile = Potassium lactate.svg
| IUPACName = Potassium 2-hydroxypropanoate
| OtherNames =
|Section1={{Chembox Identifiers
| CASNo = 996-31-6
| CASNo_Ref = {{cascite|correct|CAS}}
| PubChem = 61248
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 276897E67U
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200664
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 55189
| SMILES = [K+].[O-]C(=O)C(O)C
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI=1S/C3H6O3.K/c1-2(4)3(5)6;/h2,4H,1H3,(H,5,6);/q;+1/p-1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PHZLMBHDXVLRIX-UHFFFAOYSA-M
}}
|Section2={{Chembox Properties
| Formula = C3H5KO3
| MolarMass = 128.168
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
|Section7={{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
|Section6={{Chembox Pharmacology
| ATCCode_prefix = B05
| ATCCode_suffix = XA15
}}
}}
Potassium lactate is a compound with formula KC3H5O3. It is the potassium salt of lactic acid and appears as a clear, hygroscopic, syrupy liquid suspension that is typically 60% solids.{{Cite web |date=17 February 2015 |title=Lactic Acid, Sodium Lactate, and Potassium Lactate Handling/Processing |url=https://www.ams.usda.gov/sites/default/files/media/Lactic%20Acid%20and%20Lactates%20TR%2002-17-15%20Final.pdf |access-date=5 December 2023 |website=USDA Agricultural Marketing Service}} The substance can be concentrated to contain up to 78% solids.PURASAL http://www.purac.com/EN/Food/Brands/Potassium_lactate.aspx {{Webarchive|url=https://web.archive.org/web/20140221092834/http://www.purac.com/EN/Food/Brands/Potassium_lactate.aspx|date=2014-02-21}} It is produced by neutralizing lactic acid, which is fermented from a sugar source. It has E number E326.
Uses
=Culinary uses=
Potassium lactate is commonly used in meat and poultry products to extend shelf life and increase food safety, as it has a broad antimicrobial action and is effective at inhibiting most spoilage and pathogenic bacteria.Meat and Poultry. http://www.purac.com/EN/Food/ingredients/Meat_poultry_and_fish.aspx {{Webarchive|url=https://web.archive.org/web/20121103150815/http://www.purac.com/EN/Food/ingredients/Meat_poultry_and_fish.aspx |date=2012-11-03 }}
=Fire fighting uses=
Potassium lactate is used as an extinguishing medium in First Alert Tundra fire extinguishers. MSDS for First Alert Tundra (MSDS 06-1753A), http://www.firstalert.com/site_content/85-home/952-tundra-fire-extinguishing-spray#downloads
References
{{reflist}}
{{Organic-compound-stub}}
{{Firefighting-stub}}