Potassium salicylate

{{Chembox

| Name =

| ImageFile = Potassium salicylate.svg

| ImageClass = skin-invert-image

| PIN = Potassium 2-hydroxybenzoate

| OtherNames =

|Section1={{Chembox Identifiers

| Abbreviations =

| CASNo = 578-36-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = K91YT16P5M

| EINECS = 209-421-6

| PubChem = 23664627

| ChemSpiderID = 10877

| SMILES = [K+].O=C([O-])c1ccccc1O

| InChI = InChI=1S/C7H6O3.K/c8-6-4-2-1-3-5(6)7(9)10;/h1-4,8H,(H,9,10);/q;+1/p-1

| RTECS =

| MeSHName =

| ChEBI =

| KEGG =

}}

|Section2={{Chembox Properties

| C=7 | H=5 | K=1 | O=3

| Appearance =

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility =

| SolubleOther =

| Solvent =

| LogP =

| VaporPressure =

| HenryConstant =

| AtmosphericOHRateConstant =

| pKa =

| pKb =

}}

|Section3={{Chembox Structure

| CrystalStruct =

| Coordination =

| MolShape =

}}

|Section5={{Chembox Thermochemistry

| DeltaHf =

| DeltaHc =

| Entropy =

| HeatCapacity =

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = N02

| ATCCode_suffix = BA12

| AdminRoutes =

| Bioavail =

| Metabolism =

| HalfLife =

| ProteinBound =

| Excretion =

| Legal_status =

| Legal_US =

| Legal_UK =

| Legal_AU =

| Legal_CA =

| Pregnancy_category =

| Pregnancy_AU =

}}

|Section4={{Chembox Explosive

| ShockSens =

| FrictionSens =

| DetonationV =

| REFactor =

}}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| HPhrases =

| PPhrases =

| GHS_ref =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| LD50 =

| PEL =

}}

|Section8={{Chembox Related

| OtherAnions =

| OtherCations =

| OtherFunction =

| OtherFunction_label =

| OtherCompounds =

}}

}}

Potassium salicylate is the potassium salt of salicylic acid.{{cite web | url = http://www.chemicalbook.com/ChemicalProductProperty_EN_CB4157001.htm | title = Potassium salicylate | website = chemicalbook.com}}{{cite web | url = http://www.chemblink.com/products/578-36-9.htm | title = Potassium salicylate | website = chemblink.com}}