Potassium trithiocarbonate

{{Chembox

| ImageFile = Potassium thiocarbonate.svg

| ImageSize =

| ImageAlt =

| IUPACName =

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 26750-66-3

| CASNo_Comment =

| EC_number = 247-959-3

| PubChem = 117858

| StdInChI=1S/CH2O2S.2K/c2-1(3)4;;/h4H,(H,2,3);;/q;2*+1/p-2

| StdInChIKey = JOKZZQQDSRIMNE-UHFFFAOYSA-L

| SMILES = C(=O)([O-])[S-].[K+].[K+]

}}

|Section2={{Chembox Properties

| Formula = {{chem2|K2CS3}}

| K=2|C=1|S=3

| Appearance = White solid, often brown due to impurities

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPt =

| BoilingPt_notes =

| Solubility = }}

|Section7={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

|Section8={{Chembox Related

| OtherCompounds = Trithiocarbonic acid

}}

}}

Potassium trithiocarbonate is the inorganic compound with the chemical formula {{chem2|K2CS3|auto=1}}. It is the potassium salt of trithiocarbonic acid. It consists of two potassium cations {{chem2|K+}} and the trigonal planar trithiocarbonate dianion {{chem2|CS3(2−)}}. It is a white solid, although impure samples often appear brown. It is prepared by the reaction of potassium sulfide or potassium hydrosulfide with carbon disulfide.

:{{chem2|K2S + CS2 → K2CS3}}

Potassium trithiocarbonate reacts with alkylating agents to give trithiocarbonate esters:{{cite journal |doi=10.15227/orgsyn.039.0077 |title=Trithiocarbodiglycolic Acid |journal=Organic Syntheses |date=1959 |volume=39 |page=77|author=R. E. Strube}}

:{{chem2|K2CS3 + 2 RX → (RS)2CS + 2 KX}} (X = halogen, R = monovalent organyl group)