Pranoprofen

{{Short description|Non-steroidal anti-inflammatory drug}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 477513203

| IUPAC_name = 2-(5H-chromeno[2,3-b]pyridin-7-yl)propanoic acid

| image = Pranoprofen.png

| image_class = skin-invert-image

| tradename =

| Drugs.com = {{drugs.com|international|pranoprofen}}

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Rx-only

| routes_of_administration = Oral

| CAS_number_Ref = {{cascite|changed|??}}

| CAS_number = 52549-17-4

| ATC_prefix = S01

| ATC_suffix = BC09

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 367463

| PubChem = 4888

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 4719

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2R7O1ET613

| C=15 | H=13 | N=1 | O=3

| smiles = CC(C1=CC2=C(C=C1)OC3=C(C2)C=CC=N3)C(=O)O

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C15H13NO3/c1-9(15(17)18)10-4-5-13-12(7-10)8-11-3-2-6-16-14(11)19-13/h2-7,9H,8H2,1H3,(H,17,18)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = TVQZAMVBTVNYLA-UHFFFAOYSA-N

}}

Pranoprofen (INN) is a nonsteroidal anti-inflammatory drug (NSAID) used in ophthalmology.{{cite journal | vauthors = Akyol-Salman I, Leçe-Sertöz D, Baykal O | title = Topical pranoprofen 0.1% is as effective anti-inflammatory and analgesic agent as diclofenac sodium 0.1% after strabismus surgery | journal = Journal of Ocular Pharmacology and Therapeutics | volume = 23 | issue = 3 | pages = 280–3 | date = June 2007 | pmid = 17593012 | doi = 10.1089/jop.2006.108 }}