Prazitone

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc|display-authors=6}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 449584977

| IUPAC_name = 5-phenyl-5-(piperidin-2-ylmethyl)pyrimidine-2,4,6(1H,3H,5H)-trione

| image = Prazitone.png

| width = 200

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 2409-26-9

| ATC_prefix = none

| ATC_suffix =

| PubChem = 3050417

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 6DZB018428

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 2312482

| synonyms = AGN-511; 5-Phenyl-5-(2-piperidylmethyl)barbituric acid

| C = 16 | H = 19 | N = 3 | O = 3

| SMILES = C1CCNC(C1)CC2(C(=O)NC(=O)NC2=O)C3=CC=CC=C3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C16H19N3O3/c20-13-16(11-6-2-1-3-7-11,14(21)19-15(22)18-13)10-12-8-4-5-9-17-12/h1-3,6-7,12,17H,4-5,8-10H2,(H2,18,19,20,21,22)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = UGZAKKMLMJITLL-UHFFFAOYSA-N

}}

Prazitone ({{Abbrlink|INN|International Nonproprietary Name}}, {{Abbrlink|BAN|British Approved Name}}; developmental code name AGN-511) is a barbiturate derivative described as an antidepressant which was developed in the 1960s.{{cite book | vauthors = Elks J | title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies | publisher=Springer US | year=2014 | isbn=978-1-4757-2085-3 | url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1011 | access-date=20 October 2024 | page=1011}}{{cite patent | url = https://patents.google.com/patent/DE1645911A1/en?oq=DE1645911 | country = DE | number = 1645911 | title = Process for the preparation of derivatives of barbituric acid | inventor = Wiggins LF, Gittos MW, James JW | assign = Aspro Nicholas Ltd. | gdate = 30 May 1973 }} Unlike most barbiturates, it has little or no sedative effects, instead acting as a non-sedating anxiolytic and antidepressant.{{cite patent | url = https://patents.google.com/patent/US3806596 | country = US | number = 3806596 | inventor = Langlands R | title = Method for imparting anti-depressant and/or anxiolytic effects to animals. | assign = Aspro Nicholas Ltd. | gdate = 23 March 1974 }} The dosage range in humans is around 200–600 mg, although higher doses have been used in trials for the treatment of depression associated with Parkinson's disease.{{Citation needed|date=October 2024}}