Prednicarbate
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 396722627
| IUPAC_name = 17-[(Ethoxycarbonyl)oxy]-11β-hydroxy-3,20-dioxopregna-1,4-dien-21-yl propionate
| image = Prednicarbate.png
| width = 250px
| tradename =
| Drugs.com = {{drugs.com|monograph|prednicarbate}}
| MedlinePlus = a604021
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration = Topical
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| IUPHAR_ligand = 7605
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 73771-04-7
| ATC_prefix = D07
| ATC_suffix = AC18
| ATC_supplemental =
| PubChem = 6714002
| DrugBank_Ref = {{drugbankcite|changed|drugbank}}
| DrugBank = DB01130
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = V901LV1K7D
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 1200386
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 5145991
| smiles = O=C(OCC(=O)[C@@]1(OC(=O)OCC)CC[C@H]2[C@H]4[C@H]([C@@H](O)C[C@]12C)[C@]/3(/C=C\C(=O)\C=C\3CC4)C)CC
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C27H36O8/c1-5-22(31)34-15-21(30)27(35-24(32)33-6-2)12-10-19-18-8-7-16-13-17(28)9-11-25(16,3)23(18)20(29)14-26(19,27)4/h9,11,13,18-20,23,29H,5-8,10,12,14-15H2,1-4H3/t18-,19-,20-,23+,25-,26-,27-/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = FNPXMHRZILFCKX-KAJVQRHHSA-N
| C=27 | H=36 | O=8
| synonyms = {2-[(8S,9S,10R,11S,13S,14S,17R)-17-ethoxycarbonyloxy-11-hydroxy-10,13-dimethyl-3-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-yl]-2-oxoethyl} propanoate
}}
Prednicarbate is a relatively new topical corticosteroid drug. It is similar in potency to hydrocortisone. Corticosteroids have always been an important part of the pharmacological arsenal of dermatology; however, their tendency to produce side-effects has caused the need to search for new preparations.{{cite book|url=https://books.google.com/books?id=4-MjAQAAMAAJ|title=United States Pharmacopeia, the National Formulary|publisher=United States Pharmacopeial Convention, Incorporated|year=2008|isbn=978-1-889788-53-1|page=3060}}