Pregnane#Pregnanes

{{No footnotes|date=April 2024}}

{{chembox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 464213607

| ImageFile=Pregnane.svg

| ImageSize=

| ImageAlt=Skeletal formula of pregnane

| ImageFile1=Pregnane 3D ball.png

| ImageAlt1=Ball-and-stick model of the pregnane molecule

| IUPACName=5ξ-Pregnane{{cite book |author=International Union of Pure and Applied Chemistry |date=2014 |title=Nomenclature of Organic Chemistry: IUPAC Recommendations and Preferred Names 2013 |publisher=The Royal Society of Chemistry |pages=1530 |doi=10.1039/9781849733069 |isbn=978-0-85404-182-4}}

| SystematicName=(1S,3aS,3bS,5aΞ,9aS,9bS,11aR)-1-Ethyl-9a,11a-dimethylhexadecahydro-1H-cyclopenta[a]phenanthrene

| OtherNames=

|Section1={{Chembox Identifiers

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 5256760

| InChI = 1/C21H36/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3/h15-19H,4-14H2,1-3H3/t15-,16?,17-,18-,19-,20-,21+/m0/s1

| InChIKey = JWMFYGXQPXQEEM-WZBAXQLOBZ

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C21H36/c1-4-15-9-11-18-17-10-8-16-7-5-6-13-20(16,2)19(17)12-14-21(15,18)3/h15-19H,4-14H2,1-3H3/t15-,16?,17-,18-,19-,20-,21+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = JWMFYGXQPXQEEM-WZBAXQLOSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo = 481-26-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 10Z78HHV4C

| PubChem=6857422

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 8386

| SMILES = C41CCCC[C@@]1([C@@H]3[C@H]([C@@H]2CC[C@@H]([C@@]2(C)CC3)CC)CC4)C

}}

|Section2={{Chembox Properties

| Formula=C₂₁H₃₆

| MolarMass=288.511 g/mol

| Appearance=

| Density=0.926 g/ml

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section3={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt =

}}

}}

Pregnane, also known as 17β-ethylandrostane or as 10β,13β-dimethyl-17β-ethylgonane, is a C21 steroid and, indirectly, a parent of progesterone. It is a parent hydrocarbon for two series of steroids stemming from 5α-pregnane (originally allopregnane) and 5β-pregnane (17β-ethyletiocholane). It has a gonane core.

5β-Pregnane is the parent of pregnanediones, pregnanolones, and pregnanediols, and is found largely in urine as a metabolic product of 5β-pregnane compounds.