Prodelphinidin B9

{{Chembox

| ImageFile = Prodelphinindin B9.png

| ImageSize = 200px

| ImageAlt = Chemical structure of prodelphinindin B9

| IUPACName =

| OtherNames = Epigallocatechin-(4α→8)-catechin

|Section1={{Chembox Identifiers

| CASNo = 86631-36-9

| CASNo_Ref = {{Cascite|changed|CAS}}

| PubChem = 5089687

| StdInChI=1S/C30H26O14/c31-11-5-14(33)22-21(6-11)43-29(10-3-18(37)26(41)19(38)4-10)27(42)24(22)23-15(34)8-13(32)12-7-20(39)28(44-30(12)23)9-1-16(35)25(40)17(36)2-9/h1-6,8,20,24,27-29,31-42H,7H2

| StdInChIKey = RTEDIEITOBJPNI-WKOHRUSMSA-N

| SMILES = c1c(cc(c(c1O)O)O)[C@@H]2[C@@H](Cc3c(cc(c(c3O2)[C@@H]4c5c(cc(cc5O[C@@H]([C@@H]4O)c6cc(c(c(c6)O)O)O)O)O)O)O)O

}}

|Section2={{Chembox Properties

| C=30 | H=26 | O=13

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Prodelphinidin B9 is a prodelphinidin dimer found in beer.{{cite book | chapter = Phenolic Compounds in Beer | author = Clarissa Gerhäuser and Hans Becker | title = Beer in Health and Disease Prevention | date = 2009 | url = http://www.dkfz.de/en/tox/download/gerh/pdf-files/CH012-final.pdf }}{{Cite journal | doi =10.1016/j.foodchem.2008.02.081| pmid =26047295| title =Use of thiolysis hyphenated to RP-HPLC-ESI(−)-MS/MS for the analysis of flavanoids in fresh lager beers| journal =Food Chemistry| volume =110| issue =4| pages =1012–8| year =2008| last1 =Callemien| first1 =Delphine| last2 =Guyot| first2 =Sylvain| last3 =Collin| first3 =Sonia}}

References

{{reflist}}

Category:Condensed tannin dimers

{{aromatic-stub}}