Prodiame

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields =

| Watchedfields =

| verifiedrevid =

| IUPAC_name = (8R,9S,13S,14S,17S)-17-(3-Aminopropylamino)-13-methyl-6,7,8,9,11,12,14,15,16,17-decahydrocyclopenta[a]phenanthren-3-ol

| image = Prodiame.svg

| width = 250

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref =

| CAS_number = 87189-13-7

| CAS_supplemental =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 135893

| IUPHAR_ligand =

| DrugBank_Ref =

| DrugBank =

| ChemSpiderID_Ref =

| ChemSpiderID = 119680

| UNII =

| KEGG =

| ChEBI =

| ChEMBL =

| C=21 | H=32 | N=2 | O=1

| SMILES = C[C@]12CC[C@H]3[C@H]([C@@H]1CC[C@@H]2NCCCN)CCC4=C3C=CC(=C4)O

| StdInChI_Ref =

| StdInChI = 1S/C21H32N2O/c1-21-10-9-17-16-6-4-15(24)13-14(16)3-5-18(17)19(21)7-8-20(21)23-12-2-11-22/h4,6,13,17-20,23-24H,2-3,5,7-12,22H2,1H3/t17-,18-,19+,20+,21+/m1/s1

| StdInChIKey_Ref =

| StdInChIKey = ZIKAQUBYTJAACW-MJCUULBUSA-N

| synonyms = 17β-((3-aminopropyl)amino)estradiol; 17β-[(3-Aminopropyl)amino]estra-1,3,5(10)-trien-3-ol; N-(3-Hydroxyestra-1,3,5(10)-triene-1,3-17beta)-1,3-propylenediamine

}}

Prodiame, also known as 17β-((3-aminopropyl)amino)estradiol, is a synthetic, steroidal estrogen and a 17β-aminoestrogen with anticoagulant effects that was first described in 1983 and was never marketed.{{cite book|author=J. Elks|title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PA1023|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=1023–}}{{cite journal | vauthors = Rubio-Póo C, Mandoki JJ, Jayme V, Mendoza-Patiño N, Alvarado C, Silva G, Zavala E, Fernández-González JM, Rubio-Arroyo M | title = Prodiame: a new estrogen with sustained anticoagulant effect | journal = Proc. West. Pharmacol. Soc. | volume = 26 | pages = 111–3 | year = 1983 | pmid = 6889323 }}