Profenamine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 464215203

| IUPAC_name = N,N-Diethyl-1-(10H-phenothiazin-10-yl)propan-2-amine

| image = Profenamine.svg

| tradename = Parsidol, Parsidan, Parkisol, Parkin{{fact|date=April 2025}}

| Drugs.com = {{drugs.com|international|profenamine}}

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_UK =

| legal_US =

| protein_bound = 93%

| elimination_half-life = 1 to 2 hours

| IUPHAR_ligand = 7181

| CAS_number_Ref = {{cascite|changed|CAS}}

| CAS_number = 522-00-9

| ATC_prefix = N04

| ATC_suffix = AA05

| PubChem = 3290

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank = DB00392

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 3174

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 7WI4P02YN1

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 313639

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 1206

| C=19 | H=24 | N=2 | S=1

| smiles = S2c1ccccc1N(c3c2cccc3)CC(N(CC)CC)C

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C19H24N2S/c1-4-20(5-2)15(3)14-21-16-10-6-8-12-18(16)22-19-13-9-7-11-17(19)21/h6-13,15H,4-5,14H2,1-3H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = CDOZDBSBBXSXLB-UHFFFAOYSA-N

}}

Profenamine (INN; also known as ethopropazine (BAN); sold under the trade name Parsidol and others) is a phenothiazine derivative used as an antiparkinsonian agent{{Cite web | url = https://www.drugs.com/international/profenamine.html | title = Prefenamine | publisher = drugs.com}}{{cite book | vauthors = Morton IK, Hall JM | chapter = Ethopropazine | chapter-url = https://books.google.com/books?id=tsjrCAAAQBAJ&pg=PA115 | page = 115 |title=Concise Dictionary of Pharmacological Agents: Properties and Synonyms |date=1999 |publisher=Springer Netherlands |location=Dordrecht |isbn=9789401144391}} that has anticholinergic, antihistamine, and antiadrenergic actions. It is also used in the alleviation of the extrapyramidal syndrome induced by drugs such as other phenothiazine compounds, but, like other compounds with antimuscarinic properties, is of no value against tardive dyskinesia.