Propamidine

{{chembox

| Verifiedfields = changed

| verifiedrevid = 464216026

| ImageFile = propamidine.png

| ImageSize = 240px

| ImageName = Skeletal formula

| ImageFile1 = Propamidine-3D-balls.png

| ImageSize1 = 240px

| ImageName1 = Ball-and-stick model

| PIN = 4,4′-[Propane-1,3-diylbis(oxy)]di(benzene-1-carboximidamide)

| OtherNames =

|Section1={{Chembox Identifiers

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = G20G12V769

| UNII1_Ref = {{fdacite|correct|FDA}}

| UNII1 = 7T9IJ84C42

| UNII1_Comment = (isethionate)

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 58475

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 87462

| InChI = 1/C17H20N4O2/c18-16(19)12-2-6-14(7-3-12)22-10-1-11-23-15-8-4-13(5-9-15)17(20)21/h2-9H,1,10-11H2,(H3,18,19)(H3,20,21)

| InChIKey = WTFXJFJYEJZMFO-UHFFFAOYAO

| ChEMBL_Ref = {{ebicite|correct|EBI}}

| ChEMBL = 23013

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C17H20N4O2/c18-16(19)12-2-6-14(7-3-12)22-10-1-11-23-15-8-4-13(5-9-15)17(20)21/h2-9H,1,10-11H2,(H3,18,19)(H3,20,21)

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = WTFXJFJYEJZMFO-UHFFFAOYSA-N

| CASNo_Ref = {{cascite|correct|CAS}}

| CASNo=104-32-5

| CASNo2_Ref = {{cascite|correct|CAS}}

| CASNo2 = 140-63-6

| CASNo2_Comment = (isethionate)

| PubChem=64949

| SMILES = O(c1ccc(cc1)C(=[N@H])N)CCCOc2ccc(C(=[N@H])N)cc2

}}

|Section2={{Chembox Properties

| C=17 | H=20 | N=4 | O=2

| Appearance=

| Density=

| MeltingPt=

| BoilingPt=

| Solubility=

}}

|Section6={{Chembox Pharmacology

| ATCCode_prefix = D08

| ATCCode_suffix = AC03

| ATC_Supplemental = {{ATC|S01|AX15}}

}}

|Section7={{Chembox Hazards

| MainHazards=

| FlashPt=

| AutoignitionPt=

}}

}}

Propamidine is an antiseptic and disinfectant.

Propamidine isethionate, the salt of propamidine with isethionic acid, is used in the treatment of Acanthamoeba infection.{{cite journal |vauthors=Perrine D, Chenu JP, Georges P, Lancelot JC, Saturnino C, Robba M |title=Amoebicidal efficiencies of various diamidines against two strains of Acanthamoeba polyphaga |journal=Antimicrob. Agents Chemother. |volume=39 |issue=2 |pages=339–42 |date=February 1995 |pmid=7726493 |pmc=162538 |doi= 10.1128/aac.39.2.339}}

Propamidine is a member of the aromatic diamidine group of compounds which possess bacteriostatic properties against a wide range of organisms. These diamidines exert antibacterial action against pyrogenic cocci, antibiotic resistant staphylococci and some Gram-negative bacilli, the activity of the diamidines being retained in the presence of organic matter such as tissue fluids, pus and serum.{{Cite web|url=https://www.medicines.org.uk/emc/product/6742/smpc#PHARMACOLOGICAL_PROPS|title=Brolene Eye Drops - Summary of Product Characteristics (SmPC) - (eMC)|website=www.medicines.org.uk|language=en|access-date=2018-11-23}}