Propentofylline
{{Short description|Chemical compound}}
{{Drugbox
| Watchedfields = changed
| verifiedrevid = 447813620
| IUPAC_name = 3-methyl-1-(5-oxohexyl)-7-propyl-3,7-dihydro-1H-purine-2,6-dione
| image = Propentofylline.svg
| image_class = skin-invert-image
| tradename =
| Drugs.com = {{drugs.com|international|propentofylline}}
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 55242-55-2
| ATC_prefix = N06
| ATC_suffix = BC02
| ATC_supplemental = {{ATCvet|C04|AD90}}
| PubChem = 4938
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 5RTA398U4H
| ChemSpiderID = 4769
| C=15 | H=22 | N=4 | O=3
| smiles = CCCn1cnc2c1c(=O)n(c(=O)n2C)CCCCC(=O)C
| StdInChI = 1S/C15H22N4O3/c1-4-8-18-10-16-13-12(18)14(21)19(15(22)17(13)3)9-6-5-7-11(2)20/h10H,4-9H2,1-3H3
| StdInChIKey = RBQOQRRFDPXAGN-UHFFFAOYSA-N
}}
Propentofylline (HWA 285) is a xanthine derivative drug with purported neuroprotective effects.
Pharmacology
It is a phosphodiesterase inhibitor,{{cite journal | vauthors = Frampton M, Harvey RJ, Kirchner V | title = Propentofylline for dementia | journal = The Cochrane Database of Systematic Reviews | issue = 2 | pages = CD002853 | year = 2003 | pmid = 12804440 | doi = 10.1002/14651858.CD002853 | veditors = Frampton MA }} and also acts as an adenosine reuptake inhibitor.{{cite journal | vauthors = Salimi S, Fotouhi A, Ghoreishi A, Derakhshan MK, Khodaie-Ardakani MR, Mohammadi MR, Noorbala AA, Ahmadi-Abhari SA, Hajiazim M, Abbasi SH, Akhondzadeh S | display-authors = 6 | title = A placebo controlled study of the propentofylline added to risperidone in chronic schizophrenia | journal = Progress in Neuro-Psychopharmacology & Biological Psychiatry | volume = 32 | issue = 3 | pages = 726–732 | date = April 2008 | pmid = 18096287 | doi = 10.1016/j.pnpbp.2007.11.021 | name-list-style = vanc | s2cid = 21498202 }}{{cite journal | vauthors = Numagami Y, Marro PJ, Mishra OP, Delivoria-Papadopoulos M | title = Effect of propentofylline on free radical generation during cerebral hypoxia in the newborn piglet | journal = Neuroscience | volume = 84 | issue = 4 | pages = 1127–1133 | date = June 1998 | pmid = 9578400 | doi = 10.1016/S0306-4522(97)00542-3 | s2cid = 36155779 | doi-access = free }}
Uses
Propentofylline was studied as a possible treatment for Alzheimer's disease and multi-infarct dementia,{{cite journal | vauthors = Kittner B, Rössner M, Rother M | title = Clinical trials in dementia with propentofylline | journal = Annals of the New York Academy of Sciences | volume = 826 | issue = 1 | pages = 307–316 | date = September 1997 | pmid = 9329701 | doi = 10.1111/j.1749-6632.1997.tb48481.x | s2cid = 12493243 | bibcode = 1997NYASA.826..307K }} and has been studied, to a lesser extent, as a possible adjunct in the treatment of ischemic stroke, due to its vasodilating properties.{{cite journal | vauthors = Bath PM, Bath-Hextall FJ | title = Pentoxifylline, propentofylline and pentifylline for acute ischaemic stroke | journal = The Cochrane Database of Systematic Reviews | issue = 3 | pages = CD000162 | year = 2004 | pmid = 15266424 | doi = 10.1002/14651858.CD000162.pub2 | veditors = Bath PM }}{{cite journal | vauthors = Huber M, Kittner B, Hojer C, Fink GR, Neveling M, Heiss WD | title = Effect of propentofylline on regional cerebral glucose metabolism in acute ischemic stroke | journal = Journal of Cerebral Blood Flow and Metabolism | volume = 13 | issue = 3 | pages = 526–530 | date = May 1993 | pmid = 8478410 | doi = 10.1038/jcbfm.1993.68 | s2cid = 24909748 | doi-access = }}
Propentofylline is in use as a veterinary medicine in older dogs.{{cite news|publisher=Yorkshire Post|date=7 September 2012|title=Launch of tablet to make life easier for dogs in old age|url=https://www.yorkshirepost.co.uk/news/launch-of-tablet-to-make-life-easier-for-dogs-in-old-age-1-4904441|access-date=28 December 2019}}
See also
External links
- [https://doi.org/10.1007/978-3-642-13443-2%208 Summary of research, including possible multipartite mechanisms]
References
{{Reflist|2}}
{{Phosphodiesterase inhibitors}}
{{Purinergics}}
Category:Adenosine reuptake inhibitors
Category:Adenosine receptor antagonists
{{nervous-system-drug-stub}}