Propicillin

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 402050282

| IUPAC_name = (2S,5R,6R)-3,3-dimethyl-7-oxo-6-[(2-phenoxybutanoyl)amino]-4-thia-1-azabicyclo[3.2.0]heptane-2-carboxylic acid

| image = Propicillin structure.svg

| tradename =

| Drugs.com = {{drugs.com|international|propicillin}}

| pregnancy_AU =

| pregnancy_US =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| routes_of_administration = Oral

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 551-27-9

| ATC_prefix = J01

| ATC_suffix = CE03

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = 8X1R260V33

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1477112

| PubChem = 92879

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 83843

| smiles = CCC(C(=O)N[C@H]1[C@@H]2N(C1=O)[C@H](C(S2)(C)C)C(=O)O)OC3=CC=CC=C3

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C18H22N2O5S/c1-4-11(25-10-8-6-5-7-9-10)14(21)19-12-15(22)20-13(17(23)24)18(2,3)26-16(12)20/h5-9,11-13,16H,4H2,1-3H3,(H,19,21)(H,23,24)/t11?,12-,13+,16-/m1/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = HOCWPKXKMNXINF-XQERAMJGSA-N

| ChEBI_Ref = {{ebicite|changed|EBI}}

| ChEBI = 52429

| KEGG_Ref = {{keggcite|changed|kegg}}

| KEGG = C13110

| C=18 | H=22 | N=2 | O=5 | S=1

}}

Propicillin is a penicillin.{{cite book | vauthors = de Groot AC |title=Monographs in Contact Allergy, Volume 4: Systemic Drugs |date=2022 |publisher=CRC Press, Taylor & Francis Group |location=Boca Raton, Florida |isbn=978-1-00-054991-1 |page=823 | chapter-url=https://books.google.com/books?id=AulXEAAAQBAJ&dq=Propicillin&pg=PA823 |chapter=Propicillin}} Properties are similar to benzylpenicillin particularly used in streptococcal infections, not resistant to penicillinase. It is acid resistant and can be used orally as the potassium salt.{{cn|date=March 2023}}