Propiverine

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447824603

| IUPAC_name = 1-methylpiperidin-4-yl diphenyl(propoxy)acetate

| image = propiverine.png

| alt =

| tradename =

| Drugs.com = {{drugs.com|international|propiverine}}

| pregnancy_AU =

| pregnancy_category =

| routes_of_administration =

| legal_AU =

| legal_CA = Rx-only

| legal_CA_comment = {{cite web | title=Digestive and bladder health | website=Health Canada | date=9 May 2018 | url=https://www.canada.ca/en/services/health/drug-health-products/drug-medical-device-highlights-2017/approved-drugs/digestive-bladder-health.html | access-date=13 April 2024}}

| legal_UK =

| legal_US =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life = 20.1 h

| excretion =

| index2_label = HCl

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 60569-19-9

| CAS_number2_Ref = {{cascite|correct|CAS}}

| CAS_number2 = 54556-98-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 468GE2241L

| UNII2_Ref = {{fdacite|correct|FDA}}

| UNII2 = DC4GZD10H3

| ATC_prefix = G04

| ATC_suffix = BD06

| PubChem = 4942

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 4773

| C=23 | H=29 | N=1 | O=3

| smiles = CCCOC(C1=CC=CC=C1)(C2=CC=CC=C2)C(=O)OC3CCN(CC3)C

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C23H29NO3/c1-3-18-26-23(19-10-6-4-7-11-19,20-12-8-5-9-13-20)22(25)27-21-14-16-24(2)17-15-21/h4-13,21H,3,14-18H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = QPCVHQBVMYCJOM-UHFFFAOYSA-N

}}

Propiverine is an anticholinergic drug used for the treatment of urinary urgency, frequency and urge incontinence, all symptoms of overactive bladder syndrome.{{cite journal | vauthors = McKeage K | title = Propiverine: a review of its use in the treatment of adults and children with overactive bladder associated with idiopathic or neurogenic detrusor overactivity, and in men with lower urinary tract symptoms | journal = Clinical Drug Investigation | volume = 33 | issue = 1 | pages = 71–91 | date = January 2013 | pmid = 23288694 | doi = 10.1007/s40261-012-0046-9 | s2cid = 3399082 }}{{cite journal | vauthors = Huang W, Zong H, Zhou X, Wang T, Zhang Y | title = Efficacy and Safety of Propiverine Hydrochloride for Overactive Bladder in Adult: a Systematic Review and Meta-analysis | journal = The Indian Journal of Surgery | volume = 77 | issue = Suppl 3 | pages = 1369–1377 | date = December 2015 | pmid = 27011567 | pmc = 4775592 | doi = 10.1007/s12262-015-1264-1 }} It is a muscarinic antagonist.{{cite book |title=BNF 61 |date=March 2011 |publisher=British Medical Journal Group and Pharmaceutical Press |location=London |isbn=978-0-85369-962-0 | page = 511 }}