Propylisopropyltryptamine
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 464217567
| IUPAC_name = [2-(1H-indol-3-yl)ethyl]-N-propyl-N-isopropylamine
| image = propylisopropyltryptamine.svg
| width =
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_CA =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|??}}
| CAS_number = 1354632-00-0
| ATC_prefix = none
| ATC_suffix =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = Q2Y9D5Q4T4
| PubChem = 57464898
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 21106369
| C=16 | H=24 | N=2
| smiles = CC(C)N(CCC)CCc2c[nH]c1ccccc12
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C16H24N2/c1-4-10-18(13(2)3)11-9-14-12-17-16-8-6-5-7-15(14)16/h5-8,12-13,17H,4,9-11H2,1-3H3
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = OFXPLOPRCQJJFP-UHFFFAOYSA-N
}}
Propylisopropyltryptamine (PiPT) is a chemical in the tryptamine family, which reportedly produces psychedelic and hallucinogenic effects that resemble those of other related dialkyl tryptamine derivatives,{{cite journal | vauthors = Catalani V, Corkery JM, Guirguis A, Napoletano F, Arillotta D, Zangani C, Vento A, Schifano F | title = Psychonauts' psychedelics: A systematic, multilingual, web-crawling exercise | journal = European Neuropsychopharmacology | volume = 49 | issue = | pages = 69–92 | date = August 2021 | pmid = 33857740 | doi = 10.1016/j.euroneuro.2021.03.006 | s2cid = 233206904 | url = https://cronfa.swan.ac.uk/Record/cronfa55715 | hdl = 2299/24309 | hdl-access = free }} although PiPT is reportedly relatively weak and short lasting. It has been sold as a designer drug, first being identified in 2021 in British Columbia, Canada.{{cite report | url = https://www.bccsu.ca/wp-content/uploads/2022/07/BCCSU_BCs_Annual_Drug_Checking_Report2022.pdf | vauthors = Knill A, Tobias S, Matthews J, Ti L | title = A Report on British Columbia’s Unregulated Drug Supply. Drug checking trends across British Columbia, January to December 2021. | date = June 2022 | work = British Columbia Centre on Substance Use }}
Chemistry
Dosage
PiPT is reported as being active at doses of 50-100mg orally, or 25mg smoked.{{citation_needed|date=May 2022}}
Effects
Very little is known about the psychopharmacological properties of PiPT, but reports suggest it produces psychedelic effects similar to those of other hallucinogenic tryptamine derivatives, that can last around 2-4 hours.{{citation_needed|date=May 2022}}
Dangers
There have been no reported deaths or hospitalizations from PiPT, but its safety profile is unknown.{{citation_needed|date=May 2022}}
Legality
PiPT is unscheduled and uncontrolled in the United States, but possession and sales of PiPT could be prosecuted under the Federal Analog Act because of its structural similarities to other hallucinogenic tryptamine derivatives.
See also
References
{{Reflist}}
{{Psychedelics}}
{{Tryptamines}}
Category:N,N-Dialkyltryptamines
Category:Psychedelic tryptamines
{{hallucinogen-stub}}