Prosultiamine

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = N-[(4-amino-2-methylpyrimidin-5-yl)methyl]-N-[(1E)-4-hydroxy-1-methyl-2-(propyldisulfanyl)but-1-en-1-yl]formamide

| image = Prosultiamine.png

| image_class = skin-invert-image

| alt = Skeletal formula of prosultiamine

| width = 240

| image2 = Prosultiamine 3D ball.png

| alt2 = Ball-and-stick model of the prosultiamine molecule

| width2 = 260

| tradename =

| Drugs.com = {{drugs.com|international|prosultiamine}}

| pregnancy_category =

| legal_status = Rx-only

| routes_of_administration = Oral

| bioavailability =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 59-58-5

| ATC_prefix = None

| ATC_suffix =

| PubChem = 5355019

| ChemSpiderID = 4511078

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = UI32MM3XE3

| C=15 | H=24 | N=4 | O=2 | S=2

| smiles = O=CN(\C(=C(\SSCCC)CCO)C)Cc1cnc(nc1N)C

}}

Prosultiamine (INN; also known as thiamine propyl disulfide or TPD; brand name Jubedel,) is a disulfide thiamine derivative discovered in garlic in Japan in the 1950s, and is similar to allithiamine. It was developed as a treatment for vitamin B₁ deficiency.{{cite book | author = Swiss Pharmaceutical Society | title = Index Nominum 2000: International Drug Directory (Book with CD-ROM) | publisher = Medpharm Scientific Publishers | location = Boca Raton | year = 2000 | isbn = 3-88763-075-0 }}{{cite book | vauthors = Triggle DJ | title = Dictionary of pharmacological agents | publisher = Chapman & Hall | location = London | year = 1997 | isbn = 0-412-46630-9 }}{{Cite journal |doi = 10.1093/oxfordjournals.jbchem.a126421|title = "allithiamine" A Newly Found Derivative of Vitamin B1|journal = The Journal of Biochemistry|volume = 41|pages = 29–39|year = 1954| vauthors = Fujiwara M, Watanabe H, Matsui K }} It has improved lipid solubility relative to thiamine and is not rate-limited by dependency on intestinal transporters for absorption, hence the reasoning for its development.{{cite journal | vauthors = Thomson AD, Frank O, Baker H, Leevy CM | title = Thiamine propyl disulfide: absorption and utilization | journal = Annals of Internal Medicine | volume = 74 | issue = 4 | pages = 529–534 | date = April 1971 | pmid = 5551161 | doi = 10.7326/0003-4819-74-4-529 }}{{cite journal | vauthors = Baker H, Frank O | title = Absorption, utilization and clinical effectiveness of allithiamines compared to water-soluble thiamines | journal = Journal of Nutritional Science and Vitaminology | volume = 22 SUPPL | pages = 63–68 | date = August 1976 | pmid = 978282 | doi = 10.3177/jnsv.22.supplement_63 | doi-access = free }}