Proxyfan

{{chembox

| ImageFile = Proxyfan.svg

| ImageSize =

| PIN = 4-[3-(Benzyloxy)propyl]-1H-imidazole

| OtherNames =

| Section1 = {{Chembox Identifiers

| CASNo = 177708-09-7

| PubChem = 6421522

| IUPHAR_ligand = 1255

| ChemSpiderID = 4927056

| ChEMBL = 19173

| SMILES = C1=CC=C(C=C1)COCCCC2=CN=CN2

}}

| Section2 = {{Chembox Properties

| C=13 | H=16 | N=2 | O=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Proxyfan is a histamine H₃ receptor ligand which is a "protean agonist", producing different effects ranging from full agonist, to antagonist, to inverse agonist in different tissues, depending on the level of constitutive activity of the histamine H₃ receptor. This gives it a complex activity profile in vivo which has proven useful for scientific research.{{cite journal | pmid = 11130725 | date = 2000 | last1 = Morisset | first1 = S. | last2 = Rouleau | first2 = A. | last3 = Ligneau | first3 = X. | last4 = Gbahou | first4 = F. | last5 = Tardivel-Lacombe | first5 = J. | last6 = Stark | first6 = H. | last7 = Schunack | first7 = W. | last8 = Ganellin | first8 = C. R. | last9 = Schwartz | first9 = J. C. | last10 = Arrang | first10 = J. M. | title = High constitutive activity of native H3 receptors regulates histamine neurons in brain | journal = Nature | volume = 408 | issue = 6814 | pages = 860–864 | doi = 10.1038/35048583 }}{{cite journal | pmid = 12175472 | date = 2002 | last1 = Fox | first1 = G. B. | last2 = Pan | first2 = J. B. | last3 = Esbenshade | first3 = T. A. | last4 = Bitner | first4 = R. S. | last5 = Nikkel | first5 = A. L. | last6 = Miller | first6 = T. | last7 = Kang | first7 = C. H. | last8 = Bennani | first8 = Y. L. | last9 = Black | first9 = L. A. | last10 = Faghih | first10 = R. | last11 = Hancock | first11 = A. A. | last12 = Decker | first12 = M. W. | title = Differential in vivo effects of H3 receptor ligands in a new mouse dipsogenia model | journal = Pharmacology, Biochemistry, and Behavior | volume = 72 | issue = 3 | pages = 741–750 | doi = 10.1016/s0091-3057(02)00745-1 }}{{cite journal | pmid = 12960366| date = 2003| last1 = Gbahou| first1 = F.| last2 = Rouleau| first2 = A.| last3 = Morisset| first3 = S.| last4 = Parmentier| first4 = R.| last5 = Crochet| first5 = S.| last6 = Lin| first6 = J. S.| last7 = Ligneau| first7 = X.| last8 = Tardivel-Lacombe| first8 = J.| last9 = Stark| first9 = H.| last10 = Schunack| first10 = W.| last11 = Ganellin| first11 = C. R.| last12 = Schwartz| first12 = J. C.| last13 = Arrang| first13 = J. M.| title = Protean agonism at histamine H3 receptors in vitro and in vivo| journal = Proceedings of the National Academy of Sciences of the United States of America| volume = 100| issue = 19| pages = 11086–11091| doi = 10.1073/pnas.1932276100| doi-access = free| pmc = 196931}}{{cite journal | pmid = 15695163 | date = 2005 | last1 = Baldi | first1 = E. | last2 = Bucherelli | first2 = C. | last3 = Schunack | first3 = W. | last4 = Cenni | first4 = G. | last5 = Blandina | first5 = P. | last6 = Passani | first6 = M. B. | title = The H3 receptor protean agonist proxyfan enhances the expression of fear memory in the rat | journal = Neuropharmacology | volume = 48 | issue = 2 | pages = 246–251 | doi = 10.1016/j.neuropharm.2004.09.009 | hdl = 2158/220558 | hdl-access = free }}{{cite journal | doi = 10.1124/jpet.104.078865 | title = G Protein-Dependent Pharmacology of Histamine H₃ Receptor Ligands: Evidence for Heterogeneous Active State Receptor Conformations | date = 2005 | last1 = Krueger | first1 = Kathleen M. | last2 = Witte | first2 = David G. | last3 = Ireland-Denny | first3 = Lynne | last4 = Miller | first4 = Thomas R. | last5 = Baranowski | first5 = John L. | last6 = Buckner | first6 = Steve | last7 = Milicic | first7 = Ivan | last8 = Esbenshade | first8 = Timothy A. | last9 = Hancock | first9 = Arthur A. | journal = Journal of Pharmacology and Experimental Therapeutics | volume = 314 | issue = 1 | pages = 271–281 | pmid = 15821027 }}{{cite journal | pmid = 17573125| date = 2007| last1 = Arrang| first1 = J. M.| last2 = Morisset| first2 = S.| last3 = Gbahou| first3 = F.| title = Constitutive activity of the histamine H3 receptor| journal = Trends in Pharmacological Sciences| volume = 28| issue = 7| pages = 350–357| doi = 10.1016/j.tips.2007.05.002}}{{cite journal | doi = 10.1186/1471-2210-8-9 | doi-access = free | title = Antagonist affinity measurements at the Gi-coupled human histamine H3 receptor expressed in CHO cells | date = 2008 | last1 = Baker | first1 = Jillian G. | journal = BMC Pharmacology | volume = 8 | page = 9 | pmid = 18538007 | pmc = 2430196 }}