Proxyfan
{{chembox
| ImageFile = Proxyfan.svg
| ImageSize =
| PIN = 4-[3-(Benzyloxy)propyl]-1H-imidazole
| OtherNames =
| Section1 = {{Chembox Identifiers
| CASNo = 177708-09-7
| PubChem = 6421522
| IUPHAR_ligand = 1255
| ChemSpiderID = 4927056
| ChEMBL = 19173
| SMILES = C1=CC=C(C=C1)COCCCC2=CN=CN2
}}
| Section2 = {{Chembox Properties
| C=13 | H=16 | N=2 | O=1
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Proxyfan is a histamine H3 receptor ligand which is a "protean agonist", producing different effects ranging from full agonist, to antagonist, to inverse agonist in different tissues, depending on the level of constitutive activity of the histamine H3 receptor. This gives it a complex activity profile in vivo which has proven useful for scientific research.{{cite journal | pmid = 11130725 | date = 2000 | last1 = Morisset | first1 = S. | last2 = Rouleau | first2 = A. | last3 = Ligneau | first3 = X. | last4 = Gbahou | first4 = F. | last5 = Tardivel-Lacombe | first5 = J. | last6 = Stark | first6 = H. | last7 = Schunack | first7 = W. | last8 = Ganellin | first8 = C. R. | last9 = Schwartz | first9 = J. C. | last10 = Arrang | first10 = J. M. | title = High constitutive activity of native H3 receptors regulates histamine neurons in brain | journal = Nature | volume = 408 | issue = 6814 | pages = 860–864 | doi = 10.1038/35048583 }}{{cite journal | pmid = 12175472 | date = 2002 | last1 = Fox | first1 = G. B. | last2 = Pan | first2 = J. B. | last3 = Esbenshade | first3 = T. A. | last4 = Bitner | first4 = R. S. | last5 = Nikkel | first5 = A. L. | last6 = Miller | first6 = T. | last7 = Kang | first7 = C. H. | last8 = Bennani | first8 = Y. L. | last9 = Black | first9 = L. A. | last10 = Faghih | first10 = R. | last11 = Hancock | first11 = A. A. | last12 = Decker | first12 = M. W. | title = Differential in vivo effects of H3 receptor ligands in a new mouse dipsogenia model | journal = Pharmacology, Biochemistry, and Behavior | volume = 72 | issue = 3 | pages = 741–750 | doi = 10.1016/s0091-3057(02)00745-1 }}{{cite journal | pmid = 12960366| date = 2003| last1 = Gbahou| first1 = F.| last2 = Rouleau| first2 = A.| last3 = Morisset| first3 = S.| last4 = Parmentier| first4 = R.| last5 = Crochet| first5 = S.| last6 = Lin| first6 = J. S.| last7 = Ligneau| first7 = X.| last8 = Tardivel-Lacombe| first8 = J.| last9 = Stark| first9 = H.| last10 = Schunack| first10 = W.| last11 = Ganellin| first11 = C. R.| last12 = Schwartz| first12 = J. C.| last13 = Arrang| first13 = J. M.| title = Protean agonism at histamine H3 receptors in vitro and in vivo| journal = Proceedings of the National Academy of Sciences of the United States of America| volume = 100| issue = 19| pages = 11086–11091| doi = 10.1073/pnas.1932276100| doi-access = free| pmc = 196931}}{{cite journal | pmid = 15695163 | date = 2005 | last1 = Baldi | first1 = E. | last2 = Bucherelli | first2 = C. | last3 = Schunack | first3 = W. | last4 = Cenni | first4 = G. | last5 = Blandina | first5 = P. | last6 = Passani | first6 = M. B. | title = The H3 receptor protean agonist proxyfan enhances the expression of fear memory in the rat | journal = Neuropharmacology | volume = 48 | issue = 2 | pages = 246–251 | doi = 10.1016/j.neuropharm.2004.09.009 | hdl = 2158/220558 | hdl-access = free }}{{cite journal | doi = 10.1124/jpet.104.078865 | title = G Protein-Dependent Pharmacology of Histamine H3 Receptor Ligands: Evidence for Heterogeneous Active State Receptor Conformations | date = 2005 | last1 = Krueger | first1 = Kathleen M. | last2 = Witte | first2 = David G. | last3 = Ireland-Denny | first3 = Lynne | last4 = Miller | first4 = Thomas R. | last5 = Baranowski | first5 = John L. | last6 = Buckner | first6 = Steve | last7 = Milicic | first7 = Ivan | last8 = Esbenshade | first8 = Timothy A. | last9 = Hancock | first9 = Arthur A. | journal = Journal of Pharmacology and Experimental Therapeutics | volume = 314 | issue = 1 | pages = 271–281 | pmid = 15821027 }}{{cite journal | pmid = 17573125| date = 2007| last1 = Arrang| first1 = J. M.| last2 = Morisset| first2 = S.| last3 = Gbahou| first3 = F.| title = Constitutive activity of the histamine H3 receptor| journal = Trends in Pharmacological Sciences| volume = 28| issue = 7| pages = 350–357| doi = 10.1016/j.tips.2007.05.002}}{{cite journal | doi = 10.1186/1471-2210-8-9 | doi-access = free | title = Antagonist affinity measurements at the Gi-coupled human histamine H3 receptor expressed in CHO cells | date = 2008 | last1 = Baker | first1 = Jillian G. | journal = BMC Pharmacology | volume = 8 | page = 9 | pmid = 18538007 | pmc = 2430196 }}
References
{{Histaminergics}}
{{nervous-system-drug-stub}}