Prunetin
{{chembox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 350355577
| Name = Prunetin
| ImageFile = Prunetin.svg
| ImageSize = 220px
| ImageFile1 = Prunetin-3D-balls.png
| ImageSize1 = 220
| ImageAlt1 = Prunetin molecule
| ImageName = Chemical structure of prunetin
| IUPACName = 4′,5-Dihydroxy-7-methoxyisoflavone
| SystematicName = 5-Hydroxy-3-(4-hydroxyphenyl)-7-methoxy-4H-1-benzopyran-4-one
| OtherNames = Prunusetin
5,4'-dihydroxy-7-methoxyisoflavone
|Section1={{Chembox Identifiers
| IUPHAR_ligand = 6919
| CASNo = 552-59-0
| CASNo_Ref = {{cascite|correct|??}}
| CASNoOther =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 1TG4H5H11J
| PubChem = 5281804
| ChEBI_Ref = {{ebicite|changed|EBI}}
| ChEBI = 8600
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 491174
| SMILES = COC1=CC(=C2C(=C1)OC=C(C2=O)C3=CC=C(C=C3)O)O
| EINECS = 209-018-5
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 4445116
| InChI = 1/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3
| InChIKey = KQMVAGISDHMXJJ-UHFFFAOYAR
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C16H12O5/c1-20-11-6-13(18)15-14(7-11)21-8-12(16(15)19)9-2-4-10(17)5-3-9/h2-8,17-18H,1H3
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = KQMVAGISDHMXJJ-UHFFFAOYSA-N
| RTECS =
| MeSHName =
| KEGG_Ref = {{keggcite|changed|kegg}}
| KEGG = C10521
}}
|Section2={{Chembox Properties
| Formula = C16H12O5
| MolarMass = 284.26 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
}}
Prunetin is an O-methylated isoflavone, a type of flavonoid. It has been isolated for the first time by Finnemore in 1910 in the bark of Prunus emarginata (the Oregon cherry).{{cite journal|doi=10.1021/jo01180a006 | volume=10 | issue=4 | year=1945 | journal=The Journal of Organic Chemistry | pages=288–291 | last1 = Shriner | first1 = R. L. | last2 = Hull | first2 = Clarence J.| title=Isoflavones. III. The Structure of Prunetin and a New Synthesis of Genistein1 }} Prunetin isolated from pea roots can act as an attractant for Aphanomyces euteiches zoospores.{{cite journal | last1 = Yokosawa | first1 = Ryozo | last2 = Kuninaga | first2 = Shiro | last3 = Sekizaki | first3 = Harua | year = 1986 | title = Aphanomyces euteiches zoospore attractant isolated from pea root; prunetin | journal = Ann. Phytopath. Soc. Japan | volume = 52 | issue = 5| pages = 809–816 | doi = 10.3186/jjphytopath.52.809 | doi-access = free }} It is also an allosteric inhibitor of human liver aldehyde dehydrogenase.{{cite journal | last1 = Sheikh | first1 = S. | last2 = Weiner | first2 = H. | year = 1997 | title = Allosteric inhibition of human liver aldehyde dehydrogenase by the isoflavone prunetin | url = http://cat.inist.fr/?aModele=afficheN&cpsidt=2618386 | journal = Biochemical Pharmacology | volume = 53 | issue = 4| pages = 471–478 | doi=10.1016/s0006-2952(96)00837-4| pmid = 9105397 }}
Prunetin can lower blood pressure of spontaneously hypertensive rats and relax isolated rat aortic rings through calcium channel block mechanisms in vessel smooth muscles.{{cite journal | doi = 10.3390/molecules23092372 | doi-access = free | pmc = 6225200 | pmid = 30227625 | title = Prunetin Relaxed Isolated Rat Aortic Rings by Blocking Calcium Channels | date = 2018 | last1 = Kim | first1 = Bumjung | last2 = Jo | first2 = Cheolmin | last3 = Choi | first3 = Ho-Young | last4 = Lee | first4 = Kyungjin | journal = Molecules | volume = 23 | issue = 9 | page = 2372 }}{{Creative Commons text attribution notice|cc=by4|from this source=yes}}
Glycosides
- 8-C-glucosyl prunetin, isolated from the leaves of Dalbergia hainanensis{{cite journal | url = http://www.imm.ac.cn/journal/ccl/1307/130717-645-01-587-p4.pdf | title = Conformational Study of 8-C-glucosyl-prunetin by Dynamic NMR Spectroscopy | author = Pei Cheng Zhang, Ying Hong Wang, Xin Liu, Xiang Yi, Ruo Yun Chen and De Quan Yu | journal = Chinese Chemical Letters | volume = 13 | issue = 7 | pages = 645–648 | date = 2002 | archive-date = 2011-07-07 | access-date = 2010-02-26 | archive-url = https://web.archive.org/web/20110707013037/http://www.imm.ac.cn/journal/ccl/1307/130717-645-01-587-p4.pdf | url-status = dead }}