Pseudodillapiole
{{Chembox
| ImageFile = Pseudodillapiole.svg
| ImageSize = 200px
| ImageAlt =
| IUPACName = 4,5-Dimethoxy-7-prop-2-enyl-1,3-benzodioxole
| OtherNames = 4,5-Dimethoxy-2,3-methylenedioxy-1-allylbenzene
| Section1 = {{Chembox Identifiers
| CASNo = 23724-27-8
| PubChem = 12558252
| SMILES = COC1=C(C2=C(C(=C1)CC=C)OCO2)OC
}}
| Section2 = {{Chembox Properties
| C = 12 | H = 14 | O = 4
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
| Section3 = {{Chembox Hazards
| MainHazards =
| FlashPt =
| AutoignitionPt =
}}
}}
Pseudodillapiole (4,5-dimethoxy-2,3-methylenedioxy-1-allylbenzene) is a derivative compound of allylbenzene that acts synergistically with at least some insecticides, such as piperonyl butoxide, enhancing their insecticidal effect.{{Cite web|number=4876277 |title=Antimicrobial/antifungal compositions |date=1989-10-24 |publisher=Plant Cell Research Institute, Inc., Dublin, Calif. |url=https://patents.google.com/patent/US4876277A/en?oq=US4876277A}} Pseudodillapiole can be used to synthesize a certain amphetamine derivative, 4,5-dimethoxy-2,3-methylenedioxy-1-amphetamine, also known as DMMDA-4, which is a positional isomer of DMMDA and DMMDA-2.{{cite book | vauthors = Shulgin A, Shulgin A | title = Pihkal: A Chemical Love Story | publisher = Transform Press | year = 1991 | isbn = 0-9630096-0-5 | url = http://www.erowid.org/library/books_online/pihkal/pihkal058.shtml}} Alexander Shulgin noted this in his book PiHKAL.
