QL (chemical)

{{chembox

|Name = QL

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 428759891

| ImageFile1 = File:QL-S-enantiomer-2D-skeletal.png

| ImageSize1 =

| ImageFile2 = QL-3D-balls-by-AHRLS-2012.png

| ImageSize2 =

| ImageFile3 = QL-3D-sticks-by-AHRLS-2012.png

| ImageSize3 =

| PIN = 2-[Di(propan-2-yl)amino]ethyl ethyl methylphosphonite

| OtherNames = 2-(Diisopropylamino)ethyl ethyl methylphosphonite
N-[2-(Ethoxy(methyl)phosphanyl)oxyethyl]-N-isopropyl-propan-2-amine
Isopropyl aminoethylmethyl phosphonite
O-(2-Diisopropylaminoethyl) O'-ethyl methylphosphonite

|Section1={{Chembox Identifiers

| Abbreviations = QL

| CASNo_Ref = {{cascite|changed|CAS}}

| CASNo = 57856-11-8

| EINECS =

| PubChem = 170325

| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}

| ChemSpiderID = 148925

| UNII = 8154M6X68L

| SMILES = O(P(OCCN(C(C)C)C(C)C)C)CC

| InChI = 1/C11H26NO2P/c1-7-13-15(6)14-9-8-12(10(2)3)11(4)5/h10-11H,7-9H2,1-6H3

| InChIKey = OIQVKKOBTVZIFE-UHFFFAOYAN

| StdInChI_Ref = {{stdinchicite|correct|chemspider}}

| StdInChI = 1S/C11H26NO2P/c1-7-13-15(6)14-9-8-12(10(2)3)11(4)5/h10-11H,7-9H2,1-6H3

| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}

| StdInChIKey = OIQVKKOBTVZIFE-UHFFFAOYSA-N

}}

|Section2={{Chembox Properties

| C=11 | H=26 | N=1 | O=2 | P=1

| Appearance = Colorless liquid

| Density =

| MeltingPt =

| MeltingPt_notes =

| BoilingPtC = 230

| BoilingPt_notes =

| Solubility = Slightly soluble in water

| SolubleOther =

| Solvent =

| Odor = Strong fishy odor

| pKa =

| pKb = }}

|Section7={{Chembox Hazards

| ExternalSDS =

| MainHazards =

| NFPA-H =

| NFPA-F =

| NFPA-R =

| NFPA-S =

| HPhrases =

| PPhrases =

| GHS_ref =

| FlashPt =

| AutoignitionPt =

| ExploLimits =

| PEL = }}

}}

Isopropyl aminoethylmethyl phosphonite (NATO designation QL), also known as O-(2-diisopropylaminoethyl) {{prime|O}}-ethyl methylphosphonite, is a precursor chemical to the nerve agent VX and VR-56. It is a colorless liquid with a strong fishy odor, and is slightly soluble in water.{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/compound/170325#section=Experimental-Properties | title = Isopropyl aminoethylmethyl phosphonite | publisher = PubChem }}

Synthesis

QL is manufactured by the transesterification of diethyl methylphosphonite with 2-(diisopropylamino)ethanol.{{cite web | url = https://pubchem.ncbi.nlm.nih.gov/compound/170325#section=Use-and-Manufacturing | title = Isopropyl aminoethylmethyl phosphonite | publisher = PubChem }}

Uses in chemical warfare

QL is a component in binary chemical weapons, mainly VX nerve agent.National Research Council, et al. Systems and Technologies for the Treatment of Non-stockpile Chemical Warfare Materiel, ([https://books.google.com/books?id=Retqa9i2rY0C&dq=QL+chemical+weapon&pg=PA14 Google Books)], National Academies Press, 2002, p. 14, ({{ISBN|0309084520}}), accessed October 21, 2008. It, along with methylphosphonyl difluoride (DF), was developed during the 1980s in order to replace an aging stockpile of unitary chemical weapons. QL is listed as a Schedule 1 chemical by the Chemical Weapons Convention."Schedule One Chemicals", [http://www.cwc.gov/ Chemical Weapons Convention] {{Webarchive|url=https://web.archive.org/web/20120103055850/http://www.cwc.gov/ |date=2012-01-03 }}, US Government website, Retrieved November 15, 2008.

Toxicity

QL itself is a relatively non-toxic chemical.Croddy, Eric and Wirtz, James J. Weapons of Mass Destruction: An Encyclopedia of Worldwide Policy, Technology, and History, ([https://books.google.com/books?id=ZzlNgS70OHAC&pg=PA238 Google Books]), ABC-CLIO, 2005, p. 238, ({{ISBN|1851094903}}), accessed October 21, 2008. However, when reacting with sulfur, the corresponding sulfide of QL isomerizes into the highly toxic VX molecule.

References