Quinapyramine

{{short description|Chemical compound}}

{{Drugbox

| verifiedrevid = 384102285

| IUPAC_name = N'-(4-imino-1,2-dimethyl-6-quinolyl)-1,6-dimethylpyrimidin-1-ium-2,4-diamine

| image = quinapyramine.png

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number = 20493-41-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = B2NT1100WR

| ATCvet = yes

| ATC_prefix = P51

| ATC_suffix = DX05

| PubChem = 5351805

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID = 4508792

| chemical_formula =

| C=17 | H=21 | N=6 | charge = +

| smiles = CC1=CC(=N)C2=C(N1C)C=CC(=C2)NC3=NC(=[N+](C(=C3)C)C)N

| StdInChI=1S/C17H20N6/c1-10-7-14(18)13-9-12(5-6-15(13)22(10)3)20-16-8-11(2)23(4)17(19)21-16/h5-9,18H,1-4H3,(H2,19,20,21)/p+1/b18-14+

| StdInChIKey = KMJWBVJQFGRCEB-NBVRZTHBSA-O

}}

Quinapyramine is a trypanocidal agent for veterinary use.{{cite journal | vauthors = Hawking F, Sen AB | title = The trypanocidal action of homidium, quinapyramine and suramin | journal = British Journal of Pharmacology and Chemotherapy | volume = 15 | issue = 4 | pages = 567–70 | date = December 1960 | pmid = 13712404 | pmc = 1482270 | doi = 10.1111/j.1476-5381.1960.tb00283.x }}{{cite journal | vauthors = Ranjithkumar M, Saravanan BC, Yadav SC, Kumar R, Singh R, Dey S | s2cid = 16060891 | title = Neurological trypanosomiasis in quinapyramine sulfate-treated horses--a breach of the blood-brain barrier? | journal = Tropical Animal Health and Production | volume = 46 | issue = 2 | pages = 371–7 | date = February 2014 | pmid = 24197687 | doi = 10.1007/s11250-013-0498-9 }}