RG7795

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name =

| image = RG-7795.svg

| width = 180px

| alt =

| caption =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category=

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Investigational

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 892498-64-5

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = QTI86134YL

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| PubChem = 11587892

| DrugBank = DB06329

| ChemSpiderID = 9762656

| synonyms = RG-7795; ANA773; ANA-773

| C = 12 | H = 14 | N = 4 | O = 5 | S = 1

| StdInChIKey = HOOMGTNENMZAFP-NYNCVSEMSA-N

| StdInChI = 1S/C12H14N4O5S/c1-5(18)20-7-2-6(4-17)21-10(7)16-9-8(22-12(16)19)3-14-11(13)15-9/h3,6-7,10,17H,2,4H2,1H3,(H2,13,14,15)/t6-,7+,10+/m0/s1

| smiles = O=C1N(C=2C(S1)=CN=C(N)N2)[C@]3([C@H](OC(C)=O)C[C@@H](CO)O3)[H]

}}

RG7795 (previously ANA773) is an antiviral drug candidate that as of 2015 had been in Phase II trials in hepatitis B.{{cite web|title=RG 7795|url=http://adisinsight.springer.com/drugs/800023738| work = AdisInsight | publisher = Springer Nature Switzerland AG |access-date=28 August 2017|language=en}} It is an orally-available prodrug of isatoribine,{{cite journal | vauthors = Funk E, Kottilil S, Gilliam B, Talwani R | title = Tickling the TLR7 to cure viral hepatitis | journal = Journal of Translational Medicine | volume = 12 | pages = 129 | date = May 2014 | pmid = 24884741 | pmc = 4039542 | doi = 10.1186/1479-5876-12-129 | doi-access = free }} that was under development by Anadys Pharmaceuticals when it was acquired by Roche in 2011.{{cite news|title=Inovio Goes It Alone on Hepatitis B Immunotherapy Vaccine as Roche Ends Collaboration|url=http://www.genengnews.com/gen-news-highlights/inovio-goes-it-alone-on-hepatitis-b-immunotherapy-vaccine-as-roche-ends-collaboration/81253045|work=Genetic Engineering News|date=August 3, 2016}} Its active metabolite is an agonist of TLR7; activation of TLR7 causes secretion of endogenous type 1 interferons, which have antiviral activity.

:File:Isatoribine.svg{{clear-left}}

As of 2021, development of RG7795 appears to be discontinued.{{cite journal | journal = Advanced Drug Delivery Reviews | volume = 175 | date = 2021 | pages = 113803 | title = Evolution of Toll-like receptor 7/8 agonist therapeutics and their delivery approaches: From antiviral formulations to vaccine adjuvants | author = Sachin Bhagchandani, Jeremiah A.Johnson, and Darrell J.Irvine | doi = 10.1016/j.addr.2021.05.013 | pmid = 34058283 | pmc = 9003539 }}