RH-34
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 451555014
| IUPAC_name = 3-[2-(2-methoxybenzylamino)ethyl]-1H-quinazoline-2,4-dione
| image = RH-34_structure.png
| tradename =
| pregnancy_category =
| legal_AU =
| legal_BR = F2
| legal_BR_comment = {{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}
| legal_CA =
| legal_DE =
| legal_NZ =
| legal_UK =
| legal_US =
| legal_UN =
| legal_EU =
| legal_status = Uncontrolled
| routes_of_administration = ?
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|changed|CAS}}
| CAS_number = 1028307-48-3
| ATC_prefix = none
| ATC_suffix =
| PubChem = 10041987
| UNII_Ref = {{fdacite|changed|FDA}}
| UNII = A31AED225O
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 8217551
| C=18 | H=19 | N=3 | O=3
| smiles = O=C1C=2C(NC(=O)N1CCNCC3=C(OC)C=CC=C3)=CC=CC2
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C18H19N3O3/c1-24-16-9-5-2-6-13(16)12-19-10-11-21-17(22)14-7-3-4-8-15(14)20-18(21)23/h2-9,19H,10-12H2,1H3,(H,20,23)
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = NUAJBITWGGTZCM-UHFFFAOYSA-N
}}
RH-34 is a compound which acts as a potent and selective partial agonist for the 5-HT2A serotonin receptor subtype. It was derived by structural modification of the selective 5-HT2A antagonist ketanserin, with the 4-(p-fluorobenzoyl)piperidine moiety replaced by the N-(2-methoxybenzyl) pharmacophore found in such potent 5-HT2A agonists as NBOMe-2C-B and NBOMe-2C-I. This alteration was found to retain 5-HT2A affinity and selectivity, but reversed activity from an antagonist to a moderate efficacy partial agonist.[http://www.diss.fu-berlin.de/diss/receive/FUDISS_thesis_000000001221 Ralf Heim. Synthese und Pharmakologie potenter 5-HT2A-Rezeptoragonisten mit N-2-Methoxybenzyl-Partialstruktur. Entwicklung eines neuen Struktur-Wirkungskonzepts. (German)][http://epub.uni-regensburg.de/12119/ Maria Silva. Theoretical study of the interaction of agonists with the 5-HT2A receptor. Universität Regensburg, 2009.]{{cite journal |vauthors=Silva ME, Heim R, Strasser A, Elz S, Dove S |title=Theoretical studies on the interaction of partial agonists with the 5-HT(2A) receptor |journal=Journal of Computer-aided Molecular Design |volume=25 |issue=1 |pages=51–66 |date=January 2011 |pmid=21088982 |doi=10.1007/s10822-010-9400-2 |bibcode=2011JCAMD..25...51S |citeseerx=10.1.1.688.2670 |s2cid=3103050 }}
Legal status
RH-34 is a controlled substance in Hungary[http://www.daath.hu/incoming/designer_jogi_lista_20150903_BSZKI_Daath_kieg.pdf A Magyarországon megjelent, a Kábítószer és Kábítószer-függőség Európai Megfigyelő Központjának Korai Jelzőrendszerébe (EMCDDA EWS) 2005 óta bejelentett ellenőrzött anyagok büntetőjogi vonatkozású besorolása] and Brazil.[http://portal.anvisa.gov.br/lista-de-substancias-sujeitas-a-controle-especial Anvisa]