RS-67333

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 447929354

| IUPAC_name = 1-(4-amino-5-chloro-2-methoxyphenyl)-3-(1-butyl-4-piperidinyl)-1-propanone

| image = RS-67,333.svg

| tradename =

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 160845-95-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 39N8XG5C9A

| ATC_prefix =

| ATC_suffix =

| PubChem = 183782

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 159808

| C=19 | H=29 | N=2 | O=2 | Cl=1

| smiles = C(CCC1CCN(CC1)CCCC)(=O)c1c(cc(c(c1)Cl)N)OC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C19H29ClN2O2/c1-3-4-9-22-10-7-14(8-11-22)5-6-18(23)15-12-16(20)17(21)13-19(15)24-2/h12-14H,3-11,21H2,1-2H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JBHLYIVFFLNISJ-UHFFFAOYSA-N

}}

RS-67,333 is a drug which has been investigated as a potential rapid-acting antidepressant,{{cite journal | vauthors=Lucas G, Rymar VV, Du J, Mnie-Filali O, Bisgaard C, Manta S, Lambas-Senas L, Wiborg O, Haddjeri N, Piñeyro G, Sadikot AF, Debonnel G | title=Serotonin(4) (5-HT(4)) Receptor Agonists Are Putative Antidepressants with a Rapid Onset of Action. | journal=Neuron | year=2007 | pages=712–25 | volume=55 | issue=5 | pmid=17785179 | doi=10.1016/j.neuron.2007.07.041| s2cid=14558104 | doi-access=free }} nootropic,{{cite journal | vauthors=Lamirault L, Simon H | title=Enhancement of place and object recognition memory in young adult and old rats by RS 67333, a partial agonist of 5-HT4 receptors. | journal=Neuropharmacology | year=2001 | pages=844–53 | volume=41 | issue=7 | pmid=11684148 | doi=10.1016/S0028-3908(01)00123-X| s2cid=31707593 }} and treatment for Alzheimer's disease.{{cite journal | vauthors=Cho S, Hu Y | title=Activation of 5-HT4 receptors inhibits secretion of beta-amyloid peptides and increases neuronal survival. | journal=Experimental Neurology | year=2007 | pages=274–8 | volume=203 | issue=1 | pmid=16978609 | doi=10.1016/j.expneurol.2006.07.021| s2cid=41975593 }} It is a high-affinity 5-HT4 receptor partial agonist, as well as a sigma receptor ligand of both subtypes to a lesser extent.{{cite journal |vauthors=Eglen RM, Bonhaus DW, Johnson LG, Leung E, Clark RD |title=Pharmacological characterization of two novel and potent 5-HT4 receptor agonists, RS 67333 and RS 67506, in vitro and in vivo |journal=Br. J. Pharmacol. |volume=115 |issue=8 |pages=1387–92 |date=August 1995 |pmid=8564196 |pmc=1908873 |doi= 10.1111/j.1476-5381.1995.tb16628.x}}