RTI-150

{{Short description|Chemical compound}}

{{Infobox drug

| verifiedrevid = 449586071

| IUPAC_name = cyclobutyl (1R,2S,3S,5S)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octane-2-carboxylate

| image = RTI-150 Structure.svg

| width =

| tradename =

| routes_of_administration =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 752958-88-6

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Y8KCN7S6KE

| ATC_suffix =

| PubChem = 9972881

| ChemSpiderID = 8148473

| ChEMBL = 1812740

| C=20 | H=27 | N=1 | O=2

| smiles = CC1=CC=C(C=C1)[C@H]2C[C@@H]3CC[C@H]([C@H]2C(=O)OC4CCC4)N3C

| StdInChI = 1S/C20H27NO2/c1-13-6-8-14(9-7-13)17-12-15-10-11-18(21(15)2)19(17)20(22)23-16-4-3-5-16/h6-9,15-19H,3-5,10-12H2,1-2H3/t15-,17+,18+,19-/m0/s1

| StdInChIKey = LBLVIDUIWXYVNG-AITUJVMLSA-N

}}

RTI(-4229)-150, ((−)-2β-Carbocyclobutoxy-3β-(4-methylphenyl)tropane) is a phenyltropane derivative which acts as a potent dopamine reuptake inhibitor and stimulant drug. It is around 5x more potent than cocaine, but is more selective for the dopamine transporter relative to the other monoamine transporters. RTI-150 has a fast onset of effects and short duration of action, and its abuse potential in animal studies is similar to that of cocaine itself; its main application in scientific research has been in studies investigating the influence of pharmacokinetics on the abuse potential of stimulant drugs, with the rapid entry of RTI-150 into the brain thought to be a key factor in producing its high propensity for development of dependence in animals.{{cite journal | vauthors = Kimmel HL, Carroll FI, Kuhar MJ | title = Locomotor stimulant effects of novel phenyltropanes in the mouse | journal = Drug and Alcohol Dependence | volume = 65 | issue = 1 | pages = 25–36 | date = December 2001 | pmid = 11714587 | doi = 10.1016/s0376-8716(01)00144-2 }}{{cite journal | vauthors = Kimmel HL, O'Connor JA, Carroll FI, Howell LL | title = Faster onset and dopamine transporter selectivity predict stimulant and reinforcing effects of cocaine analogs in squirrel monkeys | journal = Pharmacology, Biochemistry, and Behavior | volume = 86 | issue = 1 | pages = 45–54 | date = January 2007 | pmid = 17258302 | pmc = 1850383 | doi = 10.1016/j.pbb.2006.12.006 }}{{cite journal | vauthors = Kimmel HL, Negus SS, Wilcox KM, Ewing SB, Stehouwer J, Goodman MM, Votaw JR, Mello NK, Carroll FI, Howell LL | display-authors = 6 | title = Relationship between rate of drug uptake in brain and behavioral pharmacology of monoamine transporter inhibitors in rhesus monkeys | journal = Pharmacology, Biochemistry, and Behavior | volume = 90 | issue = 3 | pages = 453–62 | date = September 2008 | pmid = 18468667 | pmc = 2453312 | doi = 10.1016/j.pbb.2008.03.032 }} RTI-150 is not explicitly illegal anywhere in the world, but its similar structure and pharmacological activity to cocaine makes it possible that it would be considered a controlled substance analogue in countries such as the US, Canada, Australia and New Zealand which have controlled substance analogue legislation.