RTI-160

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = [(2R,3S)-2-(Dimethylcarbamoyl)-8-methyl-8-azabicyclo[3.2.1]octan-3-yl] benzoate

| image = Cocaine analog 197b.svg

| image_class = skin-invert-image

| width = 200

| tradename =

| legal_DE =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 155748-85-9

| UNII =

| ATC_suffix =

| PubChem = 44386037

| ChemSpiderID = 24659148

| ChEMBL = 612015

| C=18 | H=24 | N=2 | O=3

| smiles = CN1C2CCC1[C@H]([C@H](C2)OC(=O)C3=CC=CC=C3)C(=O)N(C)C

| StdInChI = 1S/C18H24N2O3/c1-19(2)17(21)16-14-10-9-13(20(14)3)11-15(16)23-18(22)12-7-5-4-6-8-12/h4-8,13-16H,9-11H2,1-3H3/t13?,14?,15-,16+/m0/s1

| StdInChIKey = KCJKRDUKFUVPDP-SSHXOBKSSA-N

}}

RTI-160 (benzoylecgonine dimethylamide) is a tropane derivative drug with stimulant effects, having similar potency as a dopamine reuptake inhibitor to cocaine. It is synthesized by an amide condensation reaction between benzoylecgonine and dimethylamine.{{cite journal | vauthors = Carroll FI, Kotian P, Dehghani A, Gray JL, Kuzemko MA, Parham KA, Abraham P, Lewin AH, Boja JW, Kuhar MJ | display-authors = 6 | title = Cocaine and 3 beta-(4'-substituted phenyl)tropane-2 beta-carboxylic acid ester and amide analogues. New high-affinity and selective compounds for the dopamine transporter | journal = Journal of Medicinal Chemistry | volume = 38 | issue = 2 | pages = 379–388 | date = January 1995 | doi = 10.1021/jm00002a020 | pmid = 7830281 }}{{cite journal | vauthors = Paula S, Tabet MR, Farr CD, Norman AB, Ball WJ | title = Three-dimensional quantitative structure-activity relationship modeling of cocaine binding by a novel human monoclonal antibody | journal = Journal of Medicinal Chemistry | volume = 47 | issue = 1 | pages = 133–142 | date = January 2004 | doi = 10.1021/jm030351z | pmid = 14695827 }}