RTI-171

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451606624

| IUPAC_name = 3-methyl-5-[(1S,3S,4S,5R)-8-methyl-3-(4-methylphenyl)-8-azabicyclo[3.2.1]octan-4-yl]-1,2-oxazole

| image = RTI-171_structure.png

| tradename =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 178929-75-4

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = Q8U66P787F

| ATC_prefix =

| ATC_suffix =

| PubChem = 10565888

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 8741276

| C=19 | H=24 | N=2 | O=1

| smiles = n1oc(cc1C)[C@@H]3[C@@H]4N(C)[C@H](C[C@@H]3c2ccc(cc2)C)CC4

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C19H24N2O/c1-12-4-6-14(7-5-12)16-11-15-8-9-17(21(15)3)19(16)18-10-13(2)20-22-18/h4-7,10,15-17,19H,8-9,11H2,1-3H3/t15-,16+,17+,19-/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = JWOFBAPJYPWTNI-FAJBIJEISA-N

}}

(–)-2β-(3-Methylisoxazol-5-yl)-3β-(p-tolyl)tropane (RTI-4229-171) is a phenyltropane derivative which acts as a selective dopamine reuptake inhibitor, with a relatively slow onset of action and short duration of effects found in animal studies.{{cite journal | vauthors = Kimmel HL, Carroll FI, Kuhar MJ | title = Locomotor stimulant effects of novel phenyltropanes in the mouse | journal = Drug and Alcohol Dependence | volume = 65 | issue = 1 | pages = 25–36 | date = December 2001 | pmid = 11714587 | doi = 10.1016/S0376-8716(01)00144-2 }} However, other studies have shown it to have the most pronounced effects in terms of speed of onset and rate of stimulation among many differing phenyltropanes.{{cite journal | vauthors = Kimmel HL, O'Connor JA, Carroll FI, Howell LL | title = Faster onset and dopamine transporter selectivity predict stimulant and reinforcing effects of cocaine analogs in squirrel monkeys | journal = Pharmacology, Biochemistry, and Behavior | volume = 86 | issue = 1 | pages = 45–54 | date = January 2007 | pmid = 17258302 | pmc = 1850383 | doi = 10.1016/j.pbb.2006.12.006 }}