RTI-274
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 451224842
| IUPAC_name = 2β-([3,4-Methylenedioxy)phenoxy]methyl)-3α-(4-fluorophenyl)nortropane
| image = RTI-274.svg
| CAS_number_Ref = {{cascite|correct|CAS}}
| CAS_number = 201472-92-6
| tradename =
| PubChem = 22896771
| PubChem2 = 44320179
| ChEMBL2 = 312977
| C=21 | H=22 | F=1 | N=1 | O=3
| StdInChI=1S/C21H22FNO3/c22-14-3-1-13(2-4-14)17-9-15-5-7-19(23-15)18(17)11-24-16-6-8-20-21(10-16)26-12-25-20/h1-4,6,8,10,15,17-19,23H,5,7,9,11-12H2
| StdInChIKey = HAHQKXHPHSTOFJ-UHFFFAOYSA-N
| smiles = c4cc1OCOc1cc4OCC2C(c3ccc(F)cc3)CC5NC2CC5
| SMILES2 = C1CC2[C@@H]([C@@H](CC1N2)C3=CC=C(C=C3)F)COC4=CC5=C(C=C4)OCO5
}}
RTI(-4229)-274, or 2β-((3,4-Methyl{{wbr}}enedioxy{{wbr}}phenoxy)methyl)-3α-(4-fluorophenyl){{wbr}}nortropane is a phenyltropane homologue of paroxetine developed by the group led by F Ivy Carroll in the 1990s.{{cite journal | vauthors = Keverline-Frantz KI, Boja JW, Kuhar MJ, Abraham P, Burgess JP, Lewin AH, Carroll FI | title = Synthesis and ligand binding of tropane ring analogues of paroxetine | journal = Journal of Medicinal Chemistry | volume = 41 | issue = 2 | pages = 247–57 | date = January 1998 | pmid = 9457247 | doi = 10.1021/jm970669p }}
Introduction
Very few esters of phenyltropanes are actually known to have been reported.
NS2330 and NS2359 both have α,β stereochemistry.
NS2214 appears to have been abandoned now, RTI-336 was their latest compound.
RTI decided that they wanted to make all 8 stereoisomers of the phenyltropane paroxetine homolog.
| class="wikitable"
|colspan=5|MAT IC50 (nM) Nor/tropane-Paroxetine Hybrids | ||||
| colspan=2|Compound | [3H]CFT | [3H]Paroxetine | [3H]Nisoxetine | |
| colspan=2|Paroxetine | ? → 623 | ? → 0.28 | ? → 535 | |
| rowspan=3|R | "β,β" | 308 → 835 | 294 → 480 | 5,300 → 37,400 |
| α,β | 172 → 142 | 52.9 → 90 | 26,600 → 2,500 | |
| β,α | 3.01 → 3.86 | 422 → 5.62 | 123 → 14.4 | |
| rowspan=3|S | "β,β" | 1,050 → 1,210 | 88.1 → 424 | 27,600 → 17,300 |
| α,β | 1,500 → 27.6 | 447→ 55.8 | 2,916 → 1,690 | |
| β,α | 298 → 407 | 178 → 19 | 12,400 → 1,990 |
- N-demethylating the S-α,β (1S,2S,3R) isomer resulted in a 54-fold increase in DAT IC50.
In the case of nocaine it is understood that the SR enantiomer is the one that should be demethylated if it is wanted to improve DAT affinity.
That is the same enantiomer that is used in the production of paroxetine.
Skeletal rearrangement
Four years later some unrelated authors cited a skeletal rearrangement accounts for this.{{cite journal | vauthors = Ogier L, Turpin F, Baldwin RM, Riché F, Law H, Innis RB, Tamagnan G | title = Rearrangement of a mesylate tropane intermediate in nucleophilic substitution reactions. Synthesis of aza-bicyclo[3.2.1]octane and aza-bicyclo[3.2.2]nonane ethers, imides, and amines | journal = The Journal of Organic Chemistry | volume = 67 | issue = 11 | pages = 3637–42 | date = May 2002 | pmid = 12027674 | doi = 10.1021/jo010973x }} [http://pubs.acs.org/appl/literatum/publisher/achs/journals/production/joceah/2002/joceah.2002.67.issue-11/jo010973x/images/medium/jo010973xn00001.gif Diagram]{{Dead link|date=August 2011}}
Notice that they are not only interested in ethers, but nitrogen containing Nu's ("TRODAT")
The metal is called "Technetium" and is bound by a chelating agent.
The authors state that at first the acid is halogenated, the amide is prepared, and reduced.
{{Clear left}}
Erratum
(a) (1) 1-chloroethyl chloroformate, 1,2-dichloroethane, reflux; (2) MeOH reflux; (b) p-toluenesulfonyl chloride,
triethylamine; (c) LiAlH4, THF, rt; (d) trifluoromethanesulfonic anhydride, pyridine, CH2Cl2; (e) Na, sesamol, THF; (f) 5% Na/Hg amalgam, Na2HPO4, MeOH.
| class="wikitable"
|colspan=4|MAT IC50 (Ki) N-Methyl → De-methyl | |||
| Compound | [3H]CFT | [3H]Nisoxetine | [3H]paroxetine |
| R-β,β | ? → 3 | ? → 2 (0.2) | ? → 6 (4) |
| S-β,β | ? → ? | ? → ? (?) | ? → ? (?) |
| R-"nonane" | 308 → 835 | 294 (27) → 480 (44) | 5,300 (3200) → 37,400 (22,500) |
| S-"nonane" | 1050 → 1210 | 88 (8) → 424 (39) | 27,600 (16,600) → 17,300 (10,400) |
To solve the problem of the unexpected aza-bicyclo[3.2.2]nonane rearrangement product, the original synthesis had to be modified as follows;{{cite journal | vauthors = Runyon SP, Burgess JP, Abraham P, Keverline-Frantz KI, Flippen-Anderson J, Deschamps J, Lewin AH, Navarro HA, Boja JW, Kuhar MJ, Carroll FI | display-authors = 6 | title = Synthesis, structural identification, and ligand binding of tropane ring analogs of paroxetine and an unexpected aza-bicyclo[3.2.2]nonane rearrangement product | journal = Bioorganic & Medicinal Chemistry | volume = 13 | issue = 7 | pages = 2439–49 | date = April 2005 | pmid = 15755646 | doi = 10.1016/j.bmc.2005.01.046 }} WIN 35428 was N-demethylated and then the NH amine was reacted with a suitable protecting group so that N is no longer nucleophilic. In their case they used a tosyl.{{cite journal | vauthors = Singh S | s2cid = 36764655 | title = Chemistry, design, and structure-activity relationship of cocaine antagonists | journal = Chemical Reviews | volume = 100 | issue = 3 | pages = 925–1024 | date = March 2000 | pmid = 11749256 | doi = 10.1021/cr9700538 }}
{{Clear left}}
See also
References
{{reflist}}
{{Phenyltropanes}}
{{Stimulants}}
{{Dopaminergics}}
Category:4-Fluorophenyl compounds
Category:Dopamine reuptake inhibitors