RTI-352

{{Chembox

| ImageFile = RTI-352.svg

| ImageSize = 120px

| ImageAlt =

| IUPACName = Methyl 3α-(4-iodophenyl)tropane-2β-carboxylate

| SystematicName = Methyl (1R,2S,3R,5S)-3-(4-iodophenyl)-8-methyl-8-azabicyclo[3.2.1]octane-2-carboxylate

| OtherNames = RTI-4229-352

| Section1 = {{Chembox Identifiers

| CASNo = 184376-53-2

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = LZD6F45MKX

| ChemSpiderID = 8018798

| PubChem = 9843083

| SMILES = CN1[C@H]2CC[C@@H]1[C@@H]([C@@](OC)=O)[C@H]([C@@]3=CC=C(I)C=C3)C2

| StdInChI=1S/C16H20INO2/c1-18-12-7-8-14(18)15(16(19)20-2)13(9-12)10-3-5-11(17)6-4-10/h3-6,12-15H,7-9H2,1-2H3/t12-,13-,14+,15-/m0/s1

| StdInChIKey = SIIICDNNMDMWCI-XQLPTFJDSA-N

}}

| Section2 = {{Chembox Properties

| C=16|H=20|I=1|N=1|O=2

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

| Section3 = {{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

RTI-352 is a phenyltropane that is used as a radiolabeling ligand for the DAT.{{US Patent|6358492}}

RTI-352 is a geometric isomer of RTI-55 (β-CIT).{{Cite journal | doi = 10.1002/(SICI)1098-2396(199704)25:4<389::AID-SYN10>3.0.CO;2-Q | title = RTI-352: A 3α Analogue of RTI-55 as an in vivo dopamine transporter binding ligand | journal = Synapse | volume = 25 | issue = 4 | pages = 389–392 | year = 1997 | last1 = Zhan | first1 = Yougen | last2 = Saindane | first2 = Amit M. | last3 = Scheffel | first3 = Ursula | last4 = Carroll | first4 = F. Ivy | last5 = Holmquist | first5 = Christopher R. | last6 = Kepler | first6 = John A. | last7 = Taylor | first7 = George F. | last8 = Kuhar | first8 = Michael J. | pmid = 9097398 }}

Based on X-ray crystallography, this compound is in a tautomeric equilibrium residing mostly on the side of the boat-shaped conformer.

References