Relcovaptan

{{Short description|Chemical compound}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 455170527

| IUPAC_name = 1-({(2R,3S)-5-chloro-3-(2-chlorophenyl)-1-[(3,4-dimethoxyphenyl)sulfonyl]-3-hydroxy-2,3-dihydro-1H-indol-2-yl}carbonyl)-L-prolinamide

| image = Relcovaptan.svg

| width = 220

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 2200

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 150375-75-0

| ATC_prefix = none

| ATC_suffix =

| ATC_supplemental =

| PubChem = 60943

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 419667

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = C1GL8G6G0O

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 54910

| C=28 | H=27 | Cl=2 | N=3 | O=7 | S=1

| smiles = COC1=C(C=C(C=C1)S(=O)(=O)N2[C@H]([C@](C3=C2C=CC(=C3)Cl)(C4=CC=CC=C4Cl)O)C(=O)N5CCC[C@H]5C(=O)N)OC

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C28H27Cl2N3O7S/c1-39-23-12-10-17(15-24(23)40-2)41(37,38)33-21-11-9-16(29)14-19(21)28(36,18-6-3-4-7-20(18)30)25(33)27(35)32-13-5-8-22(32)26(31)34/h3-4,6-7,9-12,14-15,22,25,36H,5,8,13H2,1-2H3,(H2,31,34)/t22-,25-,28+/m0/s1

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = CEBYCSRFKCEUSW-NAYZPBBASA-N

| synonyms = (2S)-1-[(2R,3S)-5-chloro-3-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonyl-3-hydroxy-2H-indole-2-carbonyl]pyrrolidine-2-carboxamide

}}

Relcovaptan (SR-49059) is a non-peptide vasopressin receptor antagonist, selective for the V1A subtype.{{cite journal | vauthors = Lemmens-Gruber R, Kamyar M | title = Vasopressin antagonists | journal = Cellular and Molecular Life Sciences | volume = 63 | issue = 15 | pages = 1766–79 | date = August 2006 | pmid = 16794787 | doi = 10.1007/s00018-006-6054-2 | s2cid = 30709102 | pmc = 11136164 }} It has shown positive initial results for the treatment of Raynaud syndrome and dysmenorrhoea, and as a tocolytic,{{cite journal | vauthors = Decaux G, Soupart A, Vassart G | title = Non-peptide arginine-vasopressin antagonists: the vaptans | journal = Lancet | volume = 371 | issue = 9624 | pages = 1624–32 | date = May 2008 | pmid = 18468546 | doi = 10.1016/S0140-6736(08)60695-9 | s2cid = 1245079 }} although it is not yet approved for clinical use.

References

{{Reflist|2}}

{{Oxytocin and vasopressin receptor modulators}}

Category:Vasopressin receptor antagonists

{{systemic-hormonal-drug-stub}}