Relcovaptan
{{Short description|Chemical compound}}
{{Drugbox
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 455170527
| IUPAC_name = 1-({(2R,3S)-5-chloro-3-(2-chlorophenyl)-1-[(3,4-dimethoxyphenyl)sulfonyl]-3-hydroxy-2,3-dihydro-1H-indol-2-yl}carbonyl)-L-prolinamide
| image = Relcovaptan.svg
| width = 220
| tradename =
| pregnancy_AU =
| pregnancy_US =
| pregnancy_category =
| legal_AU =
| legal_UK =
| legal_US =
| legal_status =
| routes_of_administration =
| bioavailability =
| protein_bound =
| metabolism =
| elimination_half-life =
| excretion =
| IUPHAR_ligand = 2200
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 150375-75-0
| ATC_prefix = none
| ATC_suffix =
| ATC_supplemental =
| PubChem = 60943
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 419667
| DrugBank_Ref = {{drugbankcite|correct|drugbank}}
| DrugBank =
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = C1GL8G6G0O
| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}
| ChemSpiderID = 54910
| C=28 | H=27 | Cl=2 | N=3 | O=7 | S=1
| smiles = COC1=C(C=C(C=C1)S(=O)(=O)N2[C@H]([C@](C3=C2C=CC(=C3)Cl)(C4=CC=CC=C4Cl)O)C(=O)N5CCC[C@H]5C(=O)N)OC
| StdInChI_Ref = {{stdinchicite|changed|chemspider}}
| StdInChI = 1S/C28H27Cl2N3O7S/c1-39-23-12-10-17(15-24(23)40-2)41(37,38)33-21-11-9-16(29)14-19(21)28(36,18-6-3-4-7-20(18)30)25(33)27(35)32-13-5-8-22(32)26(31)34/h3-4,6-7,9-12,14-15,22,25,36H,5,8,13H2,1-2H3,(H2,31,34)/t22-,25-,28+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}
| StdInChIKey = CEBYCSRFKCEUSW-NAYZPBBASA-N
| synonyms = (2S)-1-[(2R,3S)-5-chloro-3-(2-chlorophenyl)-1-(3,4-dimethoxyphenyl)sulfonyl-3-hydroxy-2H-indole-2-carbonyl]pyrrolidine-2-carboxamide
}}
Relcovaptan (SR-49059) is a non-peptide vasopressin receptor antagonist, selective for the V1A subtype.{{cite journal | vauthors = Lemmens-Gruber R, Kamyar M | title = Vasopressin antagonists | journal = Cellular and Molecular Life Sciences | volume = 63 | issue = 15 | pages = 1766–79 | date = August 2006 | pmid = 16794787 | doi = 10.1007/s00018-006-6054-2 | s2cid = 30709102 | pmc = 11136164 }} It has shown positive initial results for the treatment of Raynaud syndrome and dysmenorrhoea, and as a tocolytic,{{cite journal | vauthors = Decaux G, Soupart A, Vassart G | title = Non-peptide arginine-vasopressin antagonists: the vaptans | journal = Lancet | volume = 371 | issue = 9624 | pages = 1624–32 | date = May 2008 | pmid = 18468546 | doi = 10.1016/S0140-6736(08)60695-9 | s2cid = 1245079 }} although it is not yet approved for clinical use.
References
{{Reflist|2}}
{{Oxytocin and vasopressin receptor modulators}}
Category:Vasopressin receptor antagonists
{{systemic-hormonal-drug-stub}}