Remazol Brilliant Blue R

{{Chembox

| ImageFile = Remazol Brilliant Blue R.svg

| ImageAlt =

| PIN = Disodium 1-amino-9,10-dioxo-4-{3-[2-(sulfonatooxy)ethane-1-sulfonyl]anilino}-9,10-dihydroanthracene-2-sulfonate

| OtherNames = {{plainlist|

• Reactive Blue 19
• Remazol Blue R (Special)}}

|Section1={{Chembox Identifiers

| CASNo = 2580-78-1

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = L51IMM9UP9

| PubChem = 17409

| SMILES = C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C(=C(C=C3NC4=CC(=CC=C4)S(=O)(=O)CCOS(=O)(=O)[O-])S(=O)(=O)[O-])N.[Na+].[Na+]

| InChI=1S/C22H18N2O11S3.2Na/c23-20-17(37(29,30)31)11-16(18-19(20)22(26)15-7-2-1-6-14(15)21(18)25)24-12-4-3-5-13(10-12)36(27,28)9-8-35-38(32,33)34;;/h1-7,10-11,24H,8-9,23H2,(H,29,30,31)(H,32,33,34);;/q;2*+1/p-2

| InChIKey= KUIXZSYWBHSYCN-UHFFFAOYSA-L

}}

|Section2={{Chembox Properties

| C=22 | H=16 | N=2 | Na=2 | O=11 | S=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility =

}}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt =

}}

}}

Remazol Brilliant Blue R (RBBR) is an anthraquinone dye used in textile industries. It does not decay quickly in wastewater; recent studies have suggested a biological approach to solving this problem through the use of microorganisms to degrade the dye.{{cite journal |last1=Bhatt |first1=Manish |last2=Patel |first2=Milind |last3=Rawal |first3=Bhavin |last4=Novotný |first4=Čeněk |last5=Molitoris |first5=Hans Peter |last6=Šašek |first6=Václav |title=Biological decolorization of the synthetic dye RBBR in contaminated soil |journal=World Journal of Microbiology and Biotechnology |date=2000 |volume=16 |issue=2 |pages=195–198 |doi=10.1023/A:1008937503675 |url=https://www.academia.edu/download/47827210/a_3A100893750367520160805-31554-19a7f96.pdf}}