Ritipenem

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name =

| image = Ritipenem.svg

| width =

| alt =

| image2 =

| width2 =

| drug_name =

| caption =

| tradename =

| licence_EU =

| licence_US =

| DailyMedID =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| dependency_liability =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 84845-57-8

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| ATC_supplemental =

| PubChem = 65633

| PubChemSubstance =

| IUPHAR_ligand =

| DrugBank =

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = D4SL77931L

| ChEMBL = 70088

| ChemSpiderID = 59074

| chemical_formula =

| C=10 | H=12 | Ag= | As= | Au= | B= | Bi= | Br= | Cl= | Co= | F= | Fe= | Gd= | I= | K= | Mn=

| N=2 | Na=

| O=6 | P= | Pt=

| S=1 | Se= | Sr= | Tc=| charge =

| SMILES = C[C@@H](O)[C@@H]1[C@H]2SC(=C(N2C1=O)C(=O)O)COC(=O)N

| StdInChI = 1S/C10H12N2O6S/c1-3(13)5-7(14)12-6(9(15)16)4(19-8(5)12)2-18-10(11)17/h3,5,8,13H,2H2,1H3,(H2,11,17)(H,15,16)/t3-,5+,8-/m1/s1

| StdInChIKey = IKQNRQOUOZJHTR-UWBRJAPDSA-N

| synonyms =

| density =

| melting_point =

| melting_high =

| melting_notes =

| boiling_point =

| boiling_notes =

| solubility =

| specific_rotation =

| sec_combustion =

}}

Ritipenem is a penem class antimicrobial agent. Ritipenem is manufactured by Tanabe Seiyaku in the ritipenem acoxil prodrug form, which can be taken orally . It is not FDA approved in the United States as of 2008.