Ro-318220

{{Chembox

| ImageFile = Ro-318220.svg

| ImageSize =

| ImageAlt =

| PIN = 3-{3-[4-(1-Methyl-1H-indol-3-yl)-2,5-dioxo-2,5-dihydro-1H-pyrrol-3-yl]-1H-indol-1-yl}propyl carbamimidothioate

| OtherNames =

|Section1={{Chembox Identifiers

| CASNo = 125314-64-9

| CASNo_Ref = {{cascite|correct|CAS}}

| UNII_Ref = {{fdacite|correct|FDA}}

| PubChem = 5083

| ChemSpiderID = 4905

| ChEMBL = 6291

| ChEBI = 38912

| UNII = W9A0B5E78O

| SMILES = Cn1cc(C2=C(C(=O)NC2=O)c3cn(CCCSC(=N)N)c4ccccc34)c5ccccc15

| InChI = 1/C25H23N5O2S/c1-29-13-17(15-7-2-4-9-19(15)29)21-22(24(32)28-23(21)31)18-14-30(11-6-12-33-25(26)27)20-10-5-3-8-16(18)20/h2-5,7-10,13-14H,6,11-12H2,1H3,(H3,26,27)(H,28,31,32)

| InChIKey = DSXXEELGXBCYNQ-UHFFFAOYAO

| StdInChI = 1S/C25H23N5O2S/c1-29-13-17(15-7-2-4-9-19(15)29)21-22(24(32)28-23(21)31)18-14-30(11-6-12-33-25(26)27)20-10-5-3-8-16(18)20/h2-5,7-10,13-14H,6,11-12H2,1H3,(H3,26,27)(H,28,31,32)

| StdInChIKey = DSXXEELGXBCYNQ-UHFFFAOYSA-N }}

|Section2={{Chembox Properties

| C=25 | H=23 | N=5 | O=2 | S=1

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

Ro-318220 is a protein kinase C (PKC) inhibitor of the bisindolylmaleimide class.{{Cite journal

| pmid = 8900190

| doi = 10.1074/jbc.271.43.27018

| volume = 271

| issue = 43

| pages = 27018–27024

| last = Beltman

| first = Jerlyn |author2=Frank McCormick |author3=Simon J. Cook

| title = The Selective Protein Kinase C Inhibitor, Ro-31-8220, Inhibits Mitogen-activated Protein Kinase Phosphatase-1 (MKP-1) Expression, Induces c-Jun Expression, and Activates Jun N-terminal Kinase

| journal = Journal of Biological Chemistry

| year=1996

| doi-access = free

}}