Robenacoxib

{{Short description|COX-2 selective NSAID veterinary drug}}

{{Use dmy dates|date=June 2024}}

{{cs1 config |name-list-style=vanc |display-authors=6}}

{{Infobox drug

| image = Robenacoxib.svg

| image_class = skin-invert-image

| alt =

| caption =

| pronounce =

| tradename = Onsior

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATCvet = yes

| ATC_prefix = M01

| ATC_suffix = AH91

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA = Rx-only

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US = Rx-only

| legal_US_comment = {{cite web | title=Onsior- robenacoxib injection | website=DailyMed | date=19 November 2020 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=f4f307a0-88b5-4740-b198-35edef954bf1 | access-date=29 June 2024}}{{cite web | title=Onsior- robenacoxib tablet | website=DailyMed | date=9 November 2023 | url=https://dailymed.nlm.nih.gov/dailymed/drugInfo.cfm?setid=922d3235-085e-454f-9535-44ef4bca12f4 | access-date=29 June 2024}}

| legal_EU = Rx-only

| legal_EU_comment = {{cite web | title=Onsior EPAR | website=European Medicines Agency | date=13 January 2010 | url=https://www.ema.europa.eu/en/medicines/veterinary/EPAR/onsior | access-date=29 June 2024}}

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| CAS_number = 220991-32-2

| PubChem = 6433107

| DrugBank = DB11455

| ChemSpiderID = 4938295

| ChEBI = 76269

| UNII = Z588009C7C

| ChEMBL = 2107774

| IUPAC_name = {5-Ethyl-2-[(2,3,5,6-tetrafluorophenyl)amino]phenyl}acetic acid

| C=16 | H=13 | F=4 | N=1 | O=2

| SMILES = O=C(O)Cc2c(Nc1c(F)c(F)cc(F)c1F)ccc(c2)CC

| StdInChI = 1S/C16H13F4NO2/c1-2-8-3-4-12(9(5-8)6-13(22)23)21-16-14(19)10(17)7-11(18)15(16)20/h3-5,7,21H,2,6H2,1H3,(H,22,23)

| StdInChIKey = ZEXGDYFACFXQPF-UHFFFAOYSA-N

}}

Robenacoxib, sold under the brand name Onsior, is a nonsteroidal anti-inflammatory drug (NSAID) used in veterinary medicine for the relief of pain and inflammation in cats and dogs.{{cite book| vauthors = Gaynor JS, Muir WM |title=Handbook of Veterinary Pain Management|date=2014|publisher=Elsevier Health Sciences|isbn=9780323222143|edition=3rd, revised|chapter=Robenacoxib}}{{cite book| vauthors = Clark-Price S | veditors = Egger CM, Love L, Doherty T |title=Pain management in veterinary practice.|date=2014|publisher=Wiley-Blackwell|location=Ames, Iowa|isbn=9781118761601|chapter=Nonsteroidal anti-inflammatory drugs and corticosteroids: Robenacoxib}} It is a COX-2 inhibitor (coxib).