Rufloxacin

{{Short description|Chemical compound}}

{{one source|date=August 2014}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 408210190

| IUPAC_name = 9-Fluoro-10-(4-methylpiperazin-1-yl)-7-oxo-2,3-dihydro-7H-[1,4]thiazino[2,3,4-ij]quinoline-6-carboxylic acid

| image = Rufloxacin.svg

| alt = Skeletal formula of rufloxacin

| image2 = Rufloxacin molecule spacefill.png

| alt2 = Space-filling model of the rufloxacin molecule

| tradename =

| Drugs.com = {{drugs.com|international|rufloxacin}}

| pregnancy_AU =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status = Prescription Only

| routes_of_administration = By mouth

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 101363-10-4

| CAS_supplemental = {{CAS|106017-08-7}}

| ATC_prefix = J01

| ATC_suffix = MA10

| PubChem = 58258

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| UNII_Ref = {{fdacite|changed|FDA}}

| UNII = Y521XM2900

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 295619

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 52489

| C=17 | H=18 | F=1 | N=3 | O=3 | S=1

| synonyms = 7-Fluoro-6-(4-methylpiperazin-1-yl)-10-oxo-4-thia-1-azatricyclo[7.3.1.05,13]trideca-5(13),6,8,11-tetraene-11-carboxylic acid

| smiles = CN1CCN(CC1)C2=C(C=C3C4=C2SCCN4C=C(C3=O)C(=O)O)F

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C17H18FN3O3S/c1-19-2-4-20(5-3-19)14-12(18)8-10-13-16(14)25-7-6-21(13)9-11(15(10)22)17(23)24/h8-9H,2-7H2,1H3,(H,23,24)

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = NJCJBUHJQLFDSW-UHFFFAOYSA-N

}}

Rufloxacin is a quinolone antibiotic.{{cite journal | vauthors = Rafalsky V, Andreeva I, Rjabkova E | title = Quinolones for uncomplicated acute cystitis in women | journal = The Cochrane Database of Systematic Reviews | volume = 3 | issue = 3 | pages = CD003597 | date = July 2006 | pmid = 16856014 | doi = 10.1002/14651858.CD003597.pub2 | pmc = 7003573 }} It is sold under the brand names, Ruflox, Monos, Qari, Tebraxin, Uroflox, Uroclar.

See also

References