SB-216641
{{Short description|Chemical compound}}
{{Drugbox
| verifiedrevid = 407719271
| IUPAC_name = N-[3-[3-(dimethylamino)ethoxy]-4-methoxyphenyl]-2'-methyl-4'-(5-methyl-1,2,4-oxadiazol-3-yl)-[1,1'-biphenyl]-4-carboxamide
| image = SB-216,641_structure.png
| tradename =
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| metabolism =
| elimination_half-life =
| excretion =
| CAS_number_Ref = {{cascite|correct|??}}
| CAS_number = 170230-39-4
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = ZM4360761C
| ATC_prefix = none
| ATC_suffix =
| PubChem = 3292447
| IUPHAR_ligand = 28
| ChemSpiderID = 2541153
| C=28 | H=30 | N=4 | O=4
| smiles = CN(C)CCOc1cc(ccc1OC)NC(=O)c3ccc(cc3)-c2ccc(cc2C)-c4noc(C)n4
| StdInChI = 1S/C28H30N4O4/c1-18-16-22(27-29-19(2)36-31-27)10-12-24(18)20-6-8-21(9-7-20)28(33)30-23-11-13-25(34-5)26(17-23)35-15-14-32(3)4/h6-13,16-17H,14-15H2,1-5H3,(H,30,33)
| StdInChIKey = JRNUKVFYILMMLX-UHFFFAOYSA-N
}}
SB-216641 is a drug which is a selective antagonist for the serotonin receptor 5-HT1B, with around 25x selectivity over the closely related 5-HT1D receptor.{{cite journal | vauthors = Price GW, Burton MJ, Collin LJ, Duckworth M, Gaster L, Göthert M, Jones BJ, Roberts C, Watson JM, Middlemiss DN | display-authors = 6 | title = SB-216641 and BRL-15572--compounds to pharmacologically discriminate h5-HT1B and h5-HT1D receptors | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 356 | issue = 3 | pages = 312–20 | date = September 1997 | pmid = 9303567 | doi = 10.1007/PL00005056 | s2cid = 26760453 }} It is used in scientific research,{{cite journal | vauthors = Matsuoka T, Hasuo H, Akasu T | title = 5-Hydroxytryptamine 1B receptors mediate presynaptic inhibition of monosynaptic IPSC in the rat dorsolateral septal nucleus | journal = Neuroscience Research | volume = 48 | issue = 3 | pages = 229–38 | date = March 2004 | pmid = 15154669 | doi = 10.1016/j.neures.2003.11.004 | s2cid = 35850798 }}{{cite journal | vauthors = Yan QS, Zheng SZ, Yan SE | title = Involvement of 5-HT1B receptors within the ventral tegmental area in regulation of mesolimbic dopaminergic neuronal activity via GABA mechanisms: a study with dual-probe microdialysis | journal = Brain Research | volume = 1021 | issue = 1 | pages = 82–91 | date = September 2004 | pmid = 15328035 | doi = 10.1016/j.brainres.2004.06.053 | s2cid = 46700479 }}{{cite journal | vauthors = Lee JJ, Hahm ET, Lee CH, Cho YW | title = Serotonergic modulation of GABAergic and glutamatergic synaptic transmission in mechanically isolated rat medial preoptic area neurons | journal = Neuropsychopharmacology | volume = 33 | issue = 2 | pages = 340–52 | date = January 2008 | pmid = 17392733 | doi = 10.1038/sj.npp.1301396 | doi-access = free }} and has demonstrated anxiolytic effects in animal studies.{{cite journal | vauthors = Tatarczyńska E, Kłodzińska A, Stachowicz K, Chojnacka-Wójcik E | title = Effects of a selective 5-HT1B receptor agonist and antagonists in animal models of anxiety and depression | journal = Behavioural Pharmacology | volume = 15 | issue = 8 | pages = 523–34 | date = December 2004 | pmid = 15577451 | doi = 10.1097/00008877-200412000-00001 | s2cid = 6940756 }}{{cite journal | vauthors = Chojnacka-Wójcik E, Kłodzińska A, Tatarczyńska E | title = The anxiolytic-like effect of 5-HT1B receptor ligands in rats: a possible mechanism of action | journal = The Journal of Pharmacy and Pharmacology | volume = 57 | issue = 2 | pages = 253–7 | date = February 2005 | pmid = 15720791 | doi = 10.1211/0022357055399 | s2cid = 20743875 }}