SB-399885

{{Short description|Chemical compound}}

{{cs1 config|name-list-style=vanc}}

{{Drugbox

| Verifiedfields = changed

| verifiedrevid = 449587026

| IUPAC_name = N-(3,5-Dichloro-2-methoxyphenyl)-4-methoxy-3-(1-piperazinyl)benzenesulfonamide

| image = SB-399885.svg

| width = 240

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| routes_of_administration =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| IUPHAR_ligand = 3241

| CAS_number_Ref = {{cascite|correct|??}}

| CAS_number = 402713-80-8

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 5BH7TN3FWY

| ATC_prefix =

| ATC_suffix =

| PubChem = 6918649

| ChEMBL_Ref = {{ebicite|changed|EBI}}

| ChEMBL = 1210710

| ChemSpiderID = 5293842

| C=18 | H=21 | Cl=2 | N=3 | O=4 | S=1

| smiles = C3CNCCN3c2cc(ccc2OC)S(=O)(=O)Nc(c1OC)cc(Cl)cc1Cl

| StdInChI = 1S/C18H21Cl2N3O4S/c1-26-17-4-3-13(11-16(17)23-7-5-21-6-8-23)28(24,25)22-15-10-12(19)9-14(20)18(15)27-2/h3-4,9-11,21-22H,5-8H2,1-2H3

| StdInChIKey = ATKZKAYWARYLBW-UHFFFAOYSA-N

| melting_point =

| melting_high =

}}

SB-399885 is a drug which is used in scientific research. It acts as a potent, selective and orally active 5-HT6 receptor antagonist, with a Ki of 9.0nM. SB-399885 and other 5-HT6 antagonists show nootropic effects in animal studies,{{cite journal | vauthors = Perez-García G, Meneses A | title = Oral administration of the 5-HT6 receptor antagonists SB-357134 and SB-399885 improves memory formation in an autoshaping learning task | journal = Pharmacology, Biochemistry, and Behavior | volume = 81 | issue = 3 | pages = 673–82 | date = July 2005 | pmid = 15964617 | doi = 10.1016/j.pbb.2005.05.005 | s2cid = 19789219 }}{{cite journal | vauthors = Hirst WD, Stean TO, Rogers DC, Sunter D, Pugh P, Moss SF, Bromidge SM, Riley G, Smith DR, Bartlett S, Heidbreder CA, Atkins AR, Lacroix LP, Dawson LA, Foley AG, Regan CM, Upton N | display-authors = 6 | title = SB-399885 is a potent, selective 5-HT6 receptor antagonist with cognitive enhancing properties in aged rat water maze and novel object recognition models | journal = European Journal of Pharmacology | volume = 553 | issue = 1–3 | pages = 109–19 | date = December 2006 | pmid = 17069795 | doi = 10.1016/j.ejphar.2006.09.049 }} as well as antidepressant and anxiolytic effects which are comparable to and synergistic with drugs such as imipramine and diazepam,{{cite journal | vauthors = Wesołowska A, Nikiforuk A | title = Effects of the brain-penetrant and selective 5-HT6 receptor antagonist SB-399885 in animal models of anxiety and depression | journal = Neuropharmacology | volume = 52 | issue = 5 | pages = 1274–83 | date = April 2007 | pmid = 17320917 | doi = 10.1016/j.neuropharm.2007.01.007 | s2cid = 22664564 }}{{cite journal | vauthors = Wesołowska A | title = The anxiolytic-like effect of the selective 5-HT6 receptor antagonist SB-399885: the impact of benzodiazepine receptors | journal = European Journal of Pharmacology | volume = 580 | issue = 3 | pages = 355–60 | date = February 2008 | pmid = 18096153 | doi = 10.1016/j.ejphar.2007.11.022 }}{{cite journal | vauthors = Wesołowska A, Nikiforuk A | title = The selective 5-HT(6) receptor antagonist SB-399885 enhances anti-immobility action of antidepressants in rats | journal = European Journal of Pharmacology | volume = 582 | issue = 1–3 | pages = 88–93 | date = March 2008 | pmid = 18234190 | doi = 10.1016/j.ejphar.2007.12.013 }} and have been proposed as potential novel treatments for cognitive disorders such as schizophrenia{{cite journal | vauthors = Li Z, Huang M, Prus AJ, Dai J, Meltzer HY | title = 5-HT6 receptor antagonist SB-399885 potentiates haloperidol and risperidone-induced dopamine efflux in the medial prefrontal cortex or hippocampus | journal = Brain Research | volume = 1134 | issue = 1 | pages = 70–8 | date = February 2007 | pmid = 17207474 | doi = 10.1016/j.brainres.2006.11.060 | s2cid = 21162681 }} and Alzheimer's disease.

References