SB-431542

{{Chembox

| ImageFile = SB431542.svg

| ImageSize =

| ImageAlt =

| PIN = 4-[4-(2H-1,3-Benzodioxol-5-yl)-5-(pyridin-2-yl)-1H-imidazol-2-yl]benzamide

| OtherNames =

|Section1={{Chembox Identifiers

| IUPHAR_ligand = 8216

| CASNo = 301836-41-9

| CASNo_Ref = {{Cascite|changed|CAS}}

| ChEMBL = 440084

| SMILES = NC(=O)c1ccc(cc1)c2nc(c3ccc4OCOc4c3)c([nH]2)c5ccccn5

| PubChem = 4521392

| ChemSpiderID = 3716512

| ChEBI_Ref = {{ebicite|correct|EBI}}

| ChEBI = 91108

| UNII = E1557V1V0N

| InChI = 1/C22H16N4O3/c23-21(27)13-4-6-14(7-5-13)22-25-19(20(26-22)16-3-1-2-10-24-16)15-8-9-17-18(11-15)29-12-28-17/h1-11H,12H2,(H2,23,27)(H,25,26)

| InChIKey = FHYUGAJXYORMHI-UHFFFAOYAN

| StdInChI = 1S/C22H16N4O3/c23-21(27)13-4-6-14(7-5-13)22-25-19(20(26-22)16-3-1-2-10-24-16)15-8-9-17-18(11-15)29-12-28-17/h1-11H,12H2,(H2,23,27)(H,25,26)

| StdInChIKey = FHYUGAJXYORMHI-UHFFFAOYSA-N}}

|Section2={{Chembox Properties

| C=22|H=16|N=4|O=3

| Appearance =

| Density =

| MeltingPt =

| BoilingPt =

| Solubility = }}

|Section3={{Chembox Hazards

| MainHazards =

| FlashPt =

| AutoignitionPt = }}

}}

SB-431542 is a drug candidate developed by GlaxoSmithKline (GSK) as an inhibitor of the activin receptor-like kinase (ALK) receptors, ALK5, ALK4 and ALK7. However, it is not an inhibitor of anaplastic lymphoma kinase (which are commonly known as ALK inhibitors).

In-vitro studies

While SB-431542 has not proved directly useful for any clinical application, it is used for several applications in molecular biology. It suppresses the TGF-beta-induced proliferation of osteosarcoma cells in humans.{{Cite journal

| pmid = 12065755

| volume = 62

| issue = 1

| pages = 58–64

| last = Laping

| first = NJ |author2=Grygielko E |author3=Mathur A |author4=Butter S |author5=Bomberger J |author6=Tweed C |author7=Martin W |author8=Fornwald J |author9=Lehr R |author10=Harling J |author11=Gaster L |author12=Callahan JF |author13=Olson BA

| title = Inhibition of transforming growth factor (TGF)-beta1-induced extracellular matrix with a novel inhibitor of the TGF-beta type I receptor kinase activity: SB-431542

| journal = Molecular Pharmacology

| year=2002

| doi=10.1124/mol.62.1.58

}} SB431542 can also be used in combination with LDN193189, CHIR99021 and DAPT to transform astrocytes into neurons.{{Cite journal|doi=10.1016/j.stemcr.2019.01.003|pmid=30745031|title=Chemical Conversion of Human Fetal Astrocytes into Neurons through Modulation of Multiple Signaling Pathways|journal=Stem Cell Reports|year=2019|last1=Yin|first1=Jiu-Chao|last2=Zhang|first2=Lei|last3=Ma|first3=Ning-Xin|last4=Wang|first4=Yue|last5=Lee|first5=Grace|last6=Hou|first6=Xiao-Yi|last7=Lei|first7=Zhuo-Fan|last8=Zhang|first8=Feng-Yu|last9=Dong|first9=Feng-Ping|last10=Wu|first10=Gang-Yi|last11=Chen|first11=Gong|volume=12|issue=3|pages=488–501|pmc=6409415}} It is also commonly used for immunological studies, for instance as a TGF-β inhibitor to facilitate the generation of dendritic cells from peripheral blood monocytes. {{Cite journal|doi=10.1016/j.immuni.2017.01.005|pmid=30745031|title=A Relay Pathway between Arginine and Tryptophan Metabolism Confers Immunosuppressive Properties on Dendritic Cells|journal=Immunity|author1 = Mondanelli G |author2 = Bianchi R |author3 = Pallotta MT |author4 = Orabona C |author5 = Albini E |author6 = Iacono A |author7 = Belladonna ML |author8 = Vacca C |author9 = Fallarino F |author10 = Macchiarulo A |author11 = Ugel S |author12 = Bronte V |author13 = Gevi F |author14 = Zolla L |author15 = Verhaar A |author16 = Peppelenbosch M |author17 = Mazza EMC |author18 = Bicciato S |author19 = Laouar Y |author20 = Santambrogio L |author21 = Puccetti P |author22 = Volpi C |author23 = Grohmann U |pmc=5337620| year = 2017| volume=42 | issue=2 |pages=233–244 |doi-access = free}}

References