SCH-5472

{{Short description|Stimulant drug}}

{{Drugbox

| Verifiedfields = changed

| Watchedfields = changed

| verifiedrevid = 451224999

| IUPAC_name = 2-benzhydryl-1-methyl-piperidin-3-ol

| image = SCH-5472.svg

| tradename =

| pregnancy_AU =

| pregnancy_US =

| pregnancy_category =

| legal_AU =

| legal_CA =

| legal_UK =

| legal_US =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| elimination_half-life =

| excretion =

| CAS_supplemental = (phenylsuccinate)

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 20068-90-0

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = 2D4V6AWP8N

| ATC_prefix =

| ATC_suffix =

| PubChem = 209634

| DrugBank_Ref = {{drugbankcite|correct|drugbank}}

| DrugBank =

| ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}}

| ChemSpiderID = 181634

| StdInChI_Ref = {{stdinchicite|changed|chemspider}}

| StdInChI = 1S/C19H23NO/c1-20-14-8-13-17(21)19(20)18(15-9-4-2-5-10-15)16-11-6-3-7-12-16/h2-7,9-12,17-19,21H,8,13-14H2,1H3

| StdInChIKey_Ref = {{stdinchicite|changed|chemspider}}

| StdInChIKey = DQNBDZSLMWHFTB-UHFFFAOYSA-N

| C=19 | H=23 | N=1 | O=1

| smiles = OC(CCCN1C)C1C(C2=CC=CC=C2)C3=CC=CC=C3

}}

SCH-5472. is a stimulant drug{{cite journal | vauthors = Nodine JH, Bodi T, Slap J, Levy HA, Siegler PE | title = Preliminary trial of a new stimulant SCH 5472 in ambulatory patients with depression, exhaustion, or hypersomnia syndrome | journal = Antibiotic Medicine & Clinical Therapy | volume = 7 | pages = 771–6 | date = December 1960 | pmid = 13729397 }} developed by Schering-Plough in the 1950s.{{ cite patent | country = US | status = patent | number = 2997478 | inventor = Walter LA, Sperber N | gdate = 1961-08-22 | assign1 = Schering | title = Oxygenated Piperidines and Process for their Manufacture }}