SER150

{{Short description|Pharmaceutical drug}}

{{Infobox drug

| drug_name =

| INN =

| type =

| image = SER150.svg

| alt =

| caption =

| pronounce =

| tradename =

| Drugs.com =

| MedlinePlus =

| pregnancy_AU =

| pregnancy_AU_comment =

| pregnancy_category=

| routes_of_administration =

| ATCvet =

| ATC_prefix =

| ATC_suffix =

| legal_AU =

| legal_AU_comment =

| legal_BR =

| legal_BR_comment =

| legal_CA =

| legal_CA_comment =

| legal_DE =

| legal_DE_comment =

| legal_NZ =

| legal_NZ_comment =

| legal_UK =

| legal_UK_comment =

| legal_US =

| legal_US_comment =

| legal_EU =

| legal_EU_comment =

| legal_UN =

| legal_UN_comment =

| legal_status =

| bioavailability =

| protein_bound =

| metabolism =

| metabolites =

| onset =

| elimination_half-life =

| duration_of_action=

| excretion =

| synonyms = EV 077; ICI 192605 (racemic)

| CAS_number = 1041850-31-0

| CAS_supplemental =
117621-64-4 (racemic)

| PubChem = 6604763

| DrugBank =

| IUPAC_name = (4Z)-6-[(2R,4R,5S)-2-(2-Chlorophenyl)-4-(2-hydroxyphenyl)-1,3-dioxan-5-yl]-4-hexenoic acid

| C = 22 | H = 23 | Cl = 1 | O = 5

| smiles = C(/C=C\CCC(O)=O)[C@H]1[C@H](O[C@H](OC1)C2=C(Cl)C=CC=C2)C3=C(O)C=CC=C3

| StdInChI = 1S/C22H23ClO5/c23-18-11-6-4-9-16(18)22-27-14-15(8-2-1-3-13-20(25)26)21(28-22)17-10-5-7-12-19(17)24/h1-2,4-7,9-12,15,21-22,24H,3,8,13-14H2,(H,25,26)/b2-1-/t15-,21+,22+/m1/s1

| StdInChIKey = WHUIENZXNGAHQI-GKZDNZBASA-N

}}

SER150 (formerly EV 077) is an inhibitor of thromboxane synthase and an antagonist of the thromboxane prostanoid receptor. It was developed for diabetic nephropathy.{{cite journal |last1=Kim |first1=Yoon Kook |last2=Ning |first2=Xinyuan |last3=Munir |first3=Kashif M. |last4=Davis |first4=Stephen N. |title=Emerging drugs for the treatment of diabetic nephropathy |journal=Expert Opinion on Emerging Drugs |date=2 October 2022 |volume=27 |issue=4 |pages=417–430 |doi=10.1080/14728214.2022.2155632}}{{cite book |last1=McFarlane |first1=Samy I. |title=Kidney Disease in Diabetes |date=2020 |publisher=Bentham Science Publishers |isbn=978-981-14-2199-0 |page=101 |url=https://books.google.com/books?id=fHLcDwAAQBAJ&dq=SER150+thromboxane&pg=PA90 |language=en}}{{cite journal |last1=Tan |first1=Seng Kiong |last2=Cooper |first2=Mark E. |title=Is clinical trial data showing positive progress for the treatment of diabetic kidney disease? |journal=Expert Opinion on Emerging Drugs |date=28 October 2023 |volume=28 |issue=4 |pages=217–226 |doi=10.1080/14728214.2023.2277762|doi-access=free }}