SET2
{{Short description|Chemical compound}}
{{Drugbox
| IUPAC_name = N-(furan-2-ylmethyl)-3-({4-[methyl(propyl)amino]-6-(trifluoromethyl)pyrimidin-2-yl}sulfanyl)propanamide
| image = SET2_structure.png
| width = 220
| pregnancy_category =
| legal_status =
| routes_of_administration =
| bioavailability =
| metabolism =
| excretion =
| CAS_number = 2313525-20-9
| PubChem = 155541857
| ChemSpiderID = 88296672
| ChEMBL = 4519204
| UNII =
| C=17 | H=21 | F=3 | N=4 | O=2 | S=1
| smiles = O=C(CCSc1nc(cc(n1)N(C)CCC)C(F)(F)F)NCc2ccco2
| StdInChI = 1S/C17H21F3N4O2S/c1-3-7-24(2)14-10-13(17(18,19)20)22-16(23-14)27-9-6-15(25)21-11-12-5-4-8-26-12/h4-5,8,10H,3,6-7,9,11H2,1-2H3,(H,21,25)
| StdInChIKey = LZHSWRWIMQRTOP-UHFFFAOYSA-N
}}
SET2 is a drug which acts as a selective antagonist for the TRPV2 receptor. It is moderately potent with an IC50 of 460nM, but is highly selective for TRPV2 over the other subtypes of TRPV, and is the first such compound to be developed. A role has been suggested for TRPV2 in tumor metastasis, making this a target of interest in the treatment of cancer.{{cite journal | vauthors = Chai H, Cheng X, Zhou B, Zhao L, Lin X, Huang D, Lu W, Lv H, Tang F, Zhang Q, Huang W, Li Y, Yang H | title = Structure-Based Discovery of a Subtype-Selective Inhibitor Targeting a Transient Receptor Potential Vanilloid Channel | journal = Journal of Medicinal Chemistry| volume = 62 | issue = 3 | pages = 1373–1384 | date = February 2019 | pmid = 30620187 | doi = 10.1021/acs.jmedchem.8b01496 | s2cid = 58543255 }}
See also
References
{{Reflist}}
{{Transient receptor potential channel modulators}}
Category:Trifluoromethyl compounds
{{pharm-stub}}