SN-2

{{Short description|Chemical compound}}

{{Drugbox

| IUPAC_name = 5-(2,4,6-trimethylphenyl)-3-oxa-4-azatricyclo[5.2.1.02,6]dec-4-ene

| image = SN-2_structure.png

| width = 220

| pregnancy_category =

| legal_status =

| routes_of_administration =

| bioavailability =

| metabolism =

| excretion =

| CAS_number_Ref = {{cascite|correct|CAS}}

| CAS_number = 823218-99-1

| UNII_Ref = {{fdacite|correct|FDA}}

| UNII = R4LCV6XQR7

| PubChem = 11834987

| ChemSpiderID =

| C=17 | H=21 | N=1 | O=1

| smiles = CC1=CC(=C(C(=C1)C)C2=NOC3C2C4CCC3C4)C

| StdInChI = 1S/C17H21NO/c1-9-6-10(2)14(11(3)7-9)16-15-12-4-5-13(8-12)17(15)19-18-16/h6-7,12-13,15,17H,4-5,8H2,1-3H3

| StdInChIKey = WKLZNTYMDOPBSE-UHFFFAOYSA-N

}}

SN-2 is a chemical compound which acts as an "agonist" (i.e. channel opener) for the TRPML3 calcium channel, with high selectivity for TRPML3 and no significant activity at the related TRPML1 and TRPML2 channels.{{cite journal | vauthors = Grimm C, Jörs S, Saldanha SA, Obukhov AG, Pan B, Oshima K, Cuajungco MP, Chase P, Hodder P, Heller S | display-authors = 6 | title = Small molecule activators of TRPML3 | journal = Chemistry & Biology | volume = 17 | issue = 2 | pages = 135–48 | date = February 2010 | pmid = 20189104 | doi = 10.1016/j.chembiol.2009.12.016 | pmc = 2834294 | doi-access = free }} It has demonstrated antiviral activity in an in vitro model.{{cite journal | vauthors = Xia Z, Wang L, Li S, Tang W, Sun F, Wu Y, Miao L, Cao Z | display-authors = 6 | title = ML-SA1, a selective TRPML agonist, inhibits DENV2 and ZIKV by promoting lysosomal acidification and protease activity | journal = Antiviral Research | volume = 182 | pages = 104922 | date = October 2020 | pmid = 32858116 | doi = 10.1016/j.antiviral.2020.104922 | s2cid = 221365410 }}

See also

References

{{Reflist}}

{{Transient receptor potential channel modulators}}

{{pharm-stub}}

Category:Tricyclic compounds

Category:Calcium channel openers

Category:Nitrogen heterocycles

Category:Oxygen heterocycles